seaborgium hexacarbonyl

{{chembox

|Watchedfields = changed

|verifiedrevid = 428739950

|ImageFile = Seaborgium hexacarbonyl.svg

|IUPACName = Hexacarbonylseaborgium

|OtherNames = Seaborgium carbonyl

|Section1 = {{Chembox Identifiers

|SMILES = O=C=[Sg](=C=O)(=C=O)(=C=O)(=C=O)=C=O

|StdInChIKey = GMBKQKYFDUHVHF-UHFFFAOYSA-N

|StdInChI = 1S/6CO.Sg/c6*1-2;

}}

|Section2 = {{Chembox Properties

|Formula = {{chem2|Sg(CO)6}}

|C=6|O=6|Sg=1

|Appearance =

|Density =

|MeltingPtC =

|MeltingPt_notes =

|Solubility =

|SolubleOther =

}}

|Section3 = {{Chembox Hazards

|MainHazards = Radioactive}}

|Section5 = {{Chembox Related

|OtherCations = Chromium hexacarbonyl
Molybdenum hexacarbonyl
Tungsten hexacarbonyl

}}

}}

Seaborgium hexacarbonyl (also called seaborgium carbonyl) is the organometallic compound with the formula {{chem2|Sg(CO)6}}. Like its chromium, molybdenum, and tungsten analogs, it is a volatile derivative of seaborgium in its zero oxidation state.{{Cite journal | doi = 10.1126/science.1255720| pmid = 25237098| title = Synthesis and detection of a seaborgium carbonyl complex| journal = Science| volume = 345| issue = 6203| pages = 1491–3| year = 2014| last1 = Even | first1 = J.| last2 = Yakushev | first2 = A.| last3 = Dullmann | first3 = C. E.| last4 = Haba | first4 = H.| last5 = Asai | first5 = M.| last6 = Sato | first6 = T. K.| last7 = Brand | first7 = H.| last8 = Di Nitto | first8 = A.| last9 = Eichler | first9 = R.| last10 = Fan | first10 = F. L.| last11 = Hartmann | first11 = W.| last12 = Huang | first12 = M.| last13 = Jager | first13 = E.| last14 = Kaji | first14 = D.| last15 = Kanaya | first15 = J.| last16 = Kaneya | first16 = Y.| last17 = Khuyagbaatar | first17 = J.| last18 = Kindler | first18 = B.| last19 = Kratz | first19 = J. V.| last20 = Krier | first20 = J.| last21 = Kudou | first21 = Y.| last22 = Kurz | first22 = N.| last23 = Lommel | first23 = B.| last24 = Miyashita | first24 = S.| last25 = Morimoto | first25 = K.| last26 = Morita | first26 = K.| last27 = Murakami | first27 = M.| last28 = Nagame | first28 = Y.| last29 = Nitsche | first29 = H.| last30 = Ooe | first30 = K.| display-authors = 29| bibcode = 2014Sci...345.1491E| s2cid = 206558746}} {{subscription required}} Seaborgium hexacarbonyl has little practical usage, outside of scientific interest, where it and other transactinide compounds are studied to shed light on relativistic effects on electronic structure as a consequence of high nuclear charge.