silafluofen

{{Chembox

| Verifiedfields = changed

| Watchedfields = changed

| verifiedrevid = 477857633

| ImageFile = Silafluofen.svg

| ImageSize = 200px

| PIN = (4-Ethoxyphenyl)[3-(4-fluoro-3-phenoxyphenyl)propyl]di(methyl)silane

| OtherNames = Eflusilanat; Silonen

|Section1={{Chembox Identifiers

| CASNo = 105024-66-6

| CASNo_Ref = {{cascite|changed|??}}

| UNII_Ref = {{fdacite|changed|FDA}}

| UNII = F4SX221ILG

| ChEMBL_Ref = {{ebicite|correct|EBI}}

| ChEMBL = 493481

| PubChem = 92430

| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}

| ChemSpiderID = 83448

| ChEBI_Ref = {{ebicite|correct|EBI}}

| ChEBI = 39393

| SMILES = Fc2ccc(cc2Oc1ccccc1)CCC[Si](c3ccc(OCC)cc3)(C)C

| StdInChI_Ref = {{stdinchicite|correct|chemspider}}

| StdInChI = 1S/C25H29FO2Si/c1-4-27-21-13-15-23(16-14-21)29(2,3)18-8-9-20-12-17-24(26)25(19-20)28-22-10-6-5-7-11-22/h5-7,10-17,19H,4,8-9,18H2,1-3H3

| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}

| StdInChIKey = HPYNBECUCCGGPA-UHFFFAOYSA-N

| InChI = 1/C25H29FO2Si/c1-4-27-21-13-15-23(16-14-21)29(2,3)18-8-9-20-12-17-24(26)25(19-20)28-22-10-6-5-7-11-22/h5-7,10-17,19H,4,8-9,18H2,1-3H3

| InChIKey = HPYNBECUCCGGPA-UHFFFAOYAS

}}

|Section2={{Chembox Properties

| C=25 | H=29 | F=1 | O=2 | Si=1

| Appearance =

| Density =

| MeltingPt =

| BoilingPt =

| Solubility =

}}

|Section3={{Chembox Hazards

| MainHazards =

| FlashPt =

| AutoignitionPt =

}}

}}

Silafluofen is a fluorinated organosilicon pyrethroid insecticide.{{cite journal|author1-link=Scott Sieburth |author1=Sieburth, Scott McNeill |author2=Manly, Charles J. |author3=Gammon, Derek W. | title = Organosilane insecticides. Part I: biological and physical effects of isosteric replacement of silicon for carbon in etofenprox and MTI 800 | journal = Pesticide Science | year = 1990 | volume = 28 | issue = 3 | pages = 289–307 | doi = 10.1002/ps.2780280308}}{{cite journal|author1=Showell, G. A.|author2=Mills, J. S.|title=Chemistry Challenges in Lead Optimization: Silicon Isosteres in Drug Discovery|journal=Drug Discovery Today|year=2003|volume=8|issue=12|pages=551–556|doi=10.1016/S1359-6446(03)02726-0|pmid=12821303}}

Silafluofen is used agriculturally against soil-borne insects such as termites, and as a wood preservative. It is registered in Asia (India, Japan, Taiwan, Vietnam) since at least 1995 for crops such as drupes, tea and rice, but has not been notified or authorised in the European Union for example.{{cite web |title=Silafluofen |url=https://ec.europa.eu/food/plant/pesticides/eu-pesticides-database/active-substances/?event=as.details&as_id=1132 |website=EU Pesticides database |publisher=European Commission |access-date=26 January 2022}}{{cite journal |last1=Katsuda |first1=Yoshio |last2=Minamite |first2=Yoshihiro |last3=Vongkaluang |first3=Charunee |title=Development of Silafluofen-Based Termiticides in Japan and Thailand |journal=Insects |date=December 2011 |volume=2 |issue=4 |pages=532–539 |doi=10.3390/insects2040532 |pmid=26467832 |pmc=4553446 |language=en|doi-access=free }}