simfibrate

{{Short description|Chemical compound}}

{{Drugbox

| Watchedfields = changed

| verifiedrevid = 464391792

| IUPAC_name = Propane-1,3-diyl bis[2-(4-chlorophenoxy)-2-methylpropanoate]

| image = Simfibrate.svg

| tradename = Cholesolvin

| pregnancy_AU =

| pregnancy_US =

| pregnancy_category =

| legal_AU =

| legal_CA =

| legal_UK =

| legal_US =

| legal_status =

| routes_of_administration =

| bioavailability =

| protein_bound =

| metabolism =

| elimination_half-life =

| excretion =

| CAS_number = 14929-11-4

| ATC_prefix = C10

| ATC_suffix = AB06

| PubChem = 5217

| DrugBank_Ref = {{drugbankcite|correct|drugbank}}

| DrugBank =

| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}

| ChemSpiderID = 5028

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = L2R75RQX26

| KEGG_Ref = {{keggcite|correct|kegg}}

| KEGG = D01212

| C=23 | H=26 | Cl=2 | O=6

| smiles = Clc2ccc(OC(C(=O)OCCCOC(=O)C(Oc1ccc(Cl)cc1)(C)C)(C)C)cc2

| StdInChI_Ref = {{stdinchicite|correct|chemspider}}

| StdInChI = 1S/C23H26Cl2O6/c1-22(2,30-18-10-6-16(24)7-11-18)20(26)28-14-5-15-29-21(27)23(3,4)31-19-12-8-17(25)9-13-19/h6-13H,5,14-15H2,1-4H3

| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}

| StdInChIKey = JLRNKCZRCMIVKA-UHFFFAOYSA-N

| synonyms = 3-{[2-(4-Chlorophenoxy)-2-methylpropanoyl]oxy}propyl 2-(4-chlorophenoxy)-2-methylpropanoate

}}

Simfibrate (JAN/INN; trade name Cholesolvin) is a fibrate that has been used for the treatment of hyperlipidemia.{{Cite journal | doi = 10.22159/ijcpr.2017v9i1.16616 | title = Introduction to Hyperlipidemia and its Treatment: A Review | journal = International Journal of Current Pharmaceutical Research | volume = 9 | pages = 6 | year = 2016 | last1 = Verma | first1 = Niharika | name-list-style = vanc | doi-access = free }}{{cite journal | vauthors = Olsson AG, Orö L, Rössner S | title = Clinical and metabolic effects of pentaerythritol tetranicotinate in combination with cholesolvin or clofibrate | journal = Atherosclerosis | volume = 19 | issue = 3 | pages = 407–15 | year = 1974 | pmid = 4364073 | doi = 10.1016/S0021-9150(74)80005-5 }} The substance is a double ester of clofibric acid with 1,3-propanediol which is cleaved in the body to one molecule of 1,3-propanediol and two molecules of clofibric acid which is the true lipid-lowering agent.