sodium dichloroisocyanurate

{{chembox

| Verifiedfields = changed

| Watchedfields = changed

| verifiedrevid = 476994929

| ImageFile = Sodium dichloroisocyanurate structure.svg

| ImageSize = 150px

| IUPACName = Sodium 3,5-dichloro-2,4,6-trioxo-1,3,5-triazinan-1-ide

| OtherNames = Sodium dichloroisocyanurate, Sodium troclosene, Sodic troclosene

| Section1 = {{Chembox Identifiers

| Abbreviations =

| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}

| ChemSpiderID = 451165

| InChI = 1S/C3HCl2N3O3.Na/c4-7-1(9)6-2(10)8(5)3(7)11;/h(H,6,9,10);/q;+1/p-1

| InChIKey = MSFGZHUJTJBYFA-REWHXWOFAV

| StdInChI_Ref = {{stdinchicite|correct|chemspider}}

| StdInChI = 1S/C3HCl2N3O3.Na/c4-7-1(9)6-2(10)8(5)3(7)11;/h(H,6,9,10);/q;+1/p-1

| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}

| StdInChIKey = MSFGZHUJTJBYFA-UHFFFAOYSA-M

| InChIKey1 = MSFGZHUJTJBYFA-UHFFFAOYSA-M

| CASNo_Ref = {{cascite|correct|CAS}}

| CASNo = 2893-78-9

| CASNo2_Ref = {{cascite|correct|CAS}}

| CASNo2 = 51580-86-0

| CASNo2_Comment = (dihydrate)

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = 07M9U9U0LK

| UNII2_Ref = {{fdacite|correct|FDA}}

| UNII2 = 8027SYQ9X3

| UNII2_Comment = (dihydrate)

| UNNumber = 2465 or 3077

| EINECS =

| PubChem = 517121

| SMILES = [Na+].ClN1C(=O)[N-]C(=O)N(Cl)C1=O

| RTECS = XZ1900000

| MeSHName =

| ChEBI_Ref = {{ebicite|correct|EBI}}

| ChEBI =

| KEGG_Ref = {{keggcite|correct|kegg}}

| KEGG =

}}

| Section2 = {{Chembox Properties

| Formula = C₃Cl₂N₃NaO₃

| MolarMass = 219.95 g/mol (anhydrous)

255.98 g/mol (dihydrate)

| Appearance = white, crystalline powder

| Odor = chlorine-like

| Density = 0.7 g/cm³ (as granules)

| MeltingPtC = 225

| MeltingPt_notes =

| BoilingPt =

| BoilingPt_notes =

| Solubility = 22.7 g/100 mL (25 °C)

| Solvent1 = acetone

| Solubility1 = 0.5 g/100 mL (30 °C)

| SolubleOther =

| Solvent =

| pKa = 6.2-6.8

| pKb =

}}

| Section7 = {{Chembox Hazards

| AutoignitionPt =

| ExploLimits =

| FlashPt =

| LD50 = (Rat oral) 1670 mg/kg

| MainHazards =

| NFPA-H = 2

| NFPA-F = 0

| NFPA-R = 1

| NFPA-S = W

| HPhrases = {{H-phrases|272|302|314|319|335|410}}

| PPhrases = {{P-phrases|P210|P220|P260|P261|P264|P264+P265|P270|P271|P273|P280|P301+P317|P301+P330+P331|P302+P361+P354|P304+P340|P305+P351+P338|P305+P354+P338|P316|P317|P319|P321|P330|P337+P317|P363|P370+P378|P391|P403+P233|P405|P501}}

| GHSPictograms = {{GHS03}}{{GHS05}}{{GHS07}}{{GHS09}}

| GHSSignalWord = Danger

| PEL =

}}

| Section8 = {{Chembox Related

| OtherCations = Potassium dichloroisocyanurate
Calcium dichloroisocyanurate
Lithium dichloroisocyanurate
Barium dichloroisocyanurate

}}

}}

Sodium dichloroisocyanurate (INN: sodium troclosene, troclosenum natricum or NaDCC or SDIC) is a chemical compound widely used as a cleansing agent and disinfectant.{{cite book |doi=10.1002/14356007.a08_191|chapter=Cyanuric Acid and Cyanuric Chloride|title=Ullmann's Encyclopedia of Industrial Chemistry|year=2000|last1=Huthmacher|first1=Klaus|last2=Most|first2=Dieter|isbn=3-527-30673-0|publisher=Wiley-VCH|location= Weinheim}}. It is a colorless, water-soluble solid, produced as a result of reaction of cyanuric acid with chlorine. The dihydrate is also known ({{CAS|51580-86-0}}) as is the potassium salt ({{CAS|2244-21-5}}).