sodium ferulate

{{chembox

| Verifiedfields = changed

| verifiedrevid = 464401397

| ImageFile=Sodium ferulate.png

| ImageSize=200px

| PIN=Sodium (2E)-3-(4-hydroxy-3-methoxyphenyl)prop-2-enoate

| OtherNames=

|Section1={{Chembox Identifiers

| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}

| ChemSpiderID = 4479130

| ChEBI_Ref = {{ebicite|changed|EBI}}

| ChEBI = 114954

| InChI = 1/C10H10O4.Na/c1-14-9-6-7(2-4-8(9)11)3-5-10(12)13;/h2-6,11H,1H3,(H,12,13);/q;+1/p-1/b5-3+;

| InChIKey = NCTHNHPAQAVBEB-OLHRVHTCBT

| StdInChI_Ref = {{stdinchicite|correct|chemspider}}

| StdInChI = 1S/C10H10O4.Na/c1-14-9-6-7(2-4-8(9)11)3-5-10(12)13;/h2-6,11H,1H3,(H,12,13);/q;+1/p-1/b5-3+;

| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}

| StdInChIKey = NCTHNHPAQAVBEB-WGCWOXMQSA-M

| CASNo_Ref = {{cascite|correct|CAS}}

| CASNo= 24276-84-4

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = OIS7F1IRQK

| PubChem = 5321361

| SMILES = [Na+].[O-]C(=O)\C=C\c1cc(OC)c(O)cc1

}}

|Section2={{Chembox Properties

| Formula=C10H9NaO4

| MolarMass=216.17 g/mol

| Appearance=

| Density=

| MeltingPt=

| BoilingPt=

| Solubility=

}}

|Section3={{Chembox Hazards

| MainHazards=

| FlashPt=

| AutoignitionPt =

}}

}}

Sodium ferulate, the sodium salt of ferulic acid, is a compound used in traditional Chinese medicine thought to be useful for treatment of cardiovascular and cerebrovascular diseases and to prevent thrombosis, although there is no high-quality clinical evidence for such effects. It is found in the root of Angelica sinensis. As of 2005, it was under preliminary clinical research in China.{{cite journal | doi = 10.1111/j.1527-3466.2005.tb00163.x |author1=Wang, B. H. |author2=Ou-Yang, J. P. | title = Pharmacological Actions of Sodium Ferulate in Cardiovascular System | journal = Cardiovascular Drug Reviews | year = 2005 | volume = 23 | issue = 2 | pages = 161–172 | pmid = 16007232 | doi-access = free }} Ferulic acid can also be extracted from the root of the Chinese herb Ligusticum chuanxiong.{{cite journal |author1=Wang, W. |author2=Sun, Y. | title = Ultrasonic Extraction of Ferulic Acid from Ligusticum chuanxiong | journal = Journal of the Chinese Institute of Chemical Engineers | year = 2008 | volume = 39 | issue = 6 | pages = 653–656 | doi = 10.1016/j.jcice.2008.05.012 }}

Kraft Foods patented the use of sodium ferulate to mask the aftertaste of the artificial sweetener acesulfame potassium.{{ cite patent | country = US | number = 5336513 | status = patent | gdate = 1994-08-09 | inventor = Riemer, J. A. | assign1 = Kraft General Foods | title = Bitterness Inhibitors }} (expired in 2006 due to non-payment of fees)

References