sodium ferulate
{{chembox
| Verifiedfields = changed
| verifiedrevid = 464401397
| ImageFile=Sodium ferulate.png
| ImageSize=200px
| PIN=Sodium (2E)-3-(4-hydroxy-3-methoxyphenyl)prop-2-enoate
| OtherNames=
|Section1={{Chembox Identifiers
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| ChemSpiderID = 4479130
| ChEBI_Ref = {{ebicite|changed|EBI}}
| ChEBI = 114954
| InChI = 1/C10H10O4.Na/c1-14-9-6-7(2-4-8(9)11)3-5-10(12)13;/h2-6,11H,1H3,(H,12,13);/q;+1/p-1/b5-3+;
| InChIKey = NCTHNHPAQAVBEB-OLHRVHTCBT
| StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| StdInChI = 1S/C10H10O4.Na/c1-14-9-6-7(2-4-8(9)11)3-5-10(12)13;/h2-6,11H,1H3,(H,12,13);/q;+1/p-1/b5-3+;
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
| StdInChIKey = NCTHNHPAQAVBEB-WGCWOXMQSA-M
| CASNo_Ref = {{cascite|correct|CAS}}
| CASNo= 24276-84-4
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = OIS7F1IRQK
| PubChem = 5321361
| SMILES = [Na+].[O-]C(=O)\C=C\c1cc(OC)c(O)cc1
}}
|Section2={{Chembox Properties
| Formula=C10H9NaO4
| MolarMass=216.17 g/mol
| Appearance=
| Density=
| MeltingPt=
| BoilingPt=
| Solubility=
}}
|Section3={{Chembox Hazards
| MainHazards=
| FlashPt=
| AutoignitionPt =
}}
}}
Sodium ferulate, the sodium salt of ferulic acid, is a compound used in traditional Chinese medicine thought to be useful for treatment of cardiovascular and cerebrovascular diseases and to prevent thrombosis, although there is no high-quality clinical evidence for such effects. It is found in the root of Angelica sinensis. As of 2005, it was under preliminary clinical research in China.{{cite journal | doi = 10.1111/j.1527-3466.2005.tb00163.x |author1=Wang, B. H. |author2=Ou-Yang, J. P. | title = Pharmacological Actions of Sodium Ferulate in Cardiovascular System | journal = Cardiovascular Drug Reviews | year = 2005 | volume = 23 | issue = 2 | pages = 161–172 | pmid = 16007232 | doi-access = free }} Ferulic acid can also be extracted from the root of the Chinese herb Ligusticum chuanxiong.{{cite journal |author1=Wang, W. |author2=Sun, Y. | title = Ultrasonic Extraction of Ferulic Acid from Ligusticum chuanxiong | journal = Journal of the Chinese Institute of Chemical Engineers | year = 2008 | volume = 39 | issue = 6 | pages = 653–656 | doi = 10.1016/j.jcice.2008.05.012 }}
Kraft Foods patented the use of sodium ferulate to mask the aftertaste of the artificial sweetener acesulfame potassium.{{ cite patent | country = US | number = 5336513 | status = patent | gdate = 1994-08-09 | inventor = Riemer, J. A. | assign1 = Kraft General Foods | title = Bitterness Inhibitors }} (expired in 2006 due to non-payment of fees)