somantadine

{{Short description|1978 experimental antiviral drug}}

{{cs1 config|name-list-style=vanc|display-authors=6}}

{{Infobox drug

| drug_name =

| image = Somantadine2.svg

| width =

| caption =

| pronounce =

| tradename =

| Drugs.com =

| MedlinePlus =

| licence_CA =

| licence_EU =

| DailyMedID =

| licence_US =

| pregnancy_AU =

| pregnancy_category =

| dependency_liability =

| addiction_liability =

| routes_of_administration =

| class =

| ATC_prefix =

| ATC_suffix =

| legal_status =

| bioavailability =

| protein_bound =

| metabolism =

| metabolites =

| onset =

| elimination_half-life =

| duration_of_action =

| excretion =

| CAS_number = 79594-24-4

| CAS_supplemental =

| PubChem = 50234

| IUPHAR_ligand =

| DrugBank =

| ChemSpiderID = 45554

| UNII = 02WMX1FS9Y

| KEGG =

| ChEBI =

| ChEMBL = 2111145

| NIAID_ChemDB =

| PDB_ligand =

| synonyms = PR 741-976; a,a-Dimethyl-1-adamantaneethylamine; [2-(1-Adamantyl)-1,1-dimethylethyl]amine

| IUPAC_name = 1-(1-adamantyl)-2-methylpropan-2-amine

| C=14 | H=25 | N=1

| SMILES = CC(C)(CC12CC3CC(C1)CC(C3)C2)N

| StdInChI = 1S/C14H25N/c1-13(2,15)9-14-6-10-3-11(7-14)5-12(4-10)8-14/h10-12H,3-9,15H2,1-2H3

| StdInChIKey = OWKXRDQRMTVCEX-UHFFFAOYSA-N

}}

Somantadine ({{Abbrlink|INN|International Nonproprietary Name}}; developmental code name PR 741-976), or somantadine hydrochloride ({{Abbrlink|USAN|United States Adopted Name}}) in the case of the hydrochloride salt, is an experimental antiviral drug of the adamantane family related to amantadine and rimantadine that was never marketed.{{cite book | vauthors = Elks J | title=The Dictionary of Drugs: Chemical Data: Chemical Data, Structures and Bibliographies | publisher=Springer US | year=2014 | isbn=978-1-4757-2085-3 | url=https://books.google.com/books?id=0vXTBwAAQBAJ&pg=PR2 | access-date=13 September 2024 | page=2}}{{cite book | vauthors = Milne GW | title=Ashgate Handbook of Anti-Infective Agents: An International Guide to 1, 600 Drugs in Current Use: An International Guide to 1, 600 Drugs in Current Use | publisher=Taylor & Francis | series=Routledge Revivals | year=2017 | isbn=978-1-351-73490-5 | url=https://books.google.com/books?id=9lgPEAAAQBAJ&pg=PA294 | access-date=13 September 2024 | page=294}}{{cite book | vauthors = Negwer M | title=Organic-chemical Drugs and Their Synonyms: (an International Survey) | publisher=Akademie Verlag | year=1994 | isbn=978-3-05-500156-7 | url=https://books.google.com/books?id=1ghtAAAAMAAJ | access-date=13 September 2024 | page=943}} It was first described by 1978.