sonepiprazole

{{Short description|Chemical compound}}

{{Drugbox

| IUPAC_name = 4-(4-{2-[(1S)-3,4-dihydro-1H-isochromen-1-yl]ethyl}piperazin-1-yl)benzenesulfonamide

| image = Sonepiprazole.png

| tradename =

| pregnancy_category =

| legal_status = Uncontrolled

| routes_of_administration = Oral

| bioavailability =

| metabolism =

| elimination_half-life =

| excretion =

| IUPHAR_ligand = 980

| CAS_number = 170858-33-0

| ATC_prefix = none

| ATC_suffix =

| PubChem = 133079

| ChemSpiderID = 117441

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = O609V24217

| CAS_number_Ref = {{cascite|correct|CAS}}

| index2_label = as salt

| CAS_number2_Ref = {{cascite|correct|CAS}}

| CAS_number2 = 170858-34-1

| UNII2_Ref = {{fdacite|correct|FDA}}

| UNII2 = 980MD32QLW

| C=21 | H=27 | N=3 | O=3 | S=1

| smiles = O=S(=O)(N)c1ccc(cc1)N2CCN(CC2)CC[C@@H]4OCCc3ccccc34

}}

Sonepiprazole (U-101,387, PNU-101,387-G) is a drug of the phenylpiperazine class which acts as a highly selective D4 receptor antagonist.{{cite journal |vauthors=TenBrink RE, Bergh CL, Duncan JN, etal | title = (S)-(−)-4-[4-[2-(isochroman-1-yl)ethyl]-piperazin-1-yl] benzenesulfonamide, a selective dopamine D4 antagonist | journal = Journal of Medicinal Chemistry | volume = 39 | issue = 13 | pages = 2435–7 |date=June 1996 | pmid = 8691438 | doi = 10.1021/jm960084f }} In animals, unlike D2 receptor antagonists like haloperidol, sonepiprazole does not block the behavioral effects of amphetamine or apomorphine, does not alter spontaneous locomotor activity on its own, and lacks extrapyramidal and neuroendocrine effects.{{cite journal |vauthors=Merchant KM, Gill GS, Harris DW, etal | title = Pharmacological characterization of U-101387, a dopamine D4 receptor selective antagonist | journal = The Journal of Pharmacology and Experimental Therapeutics | volume = 279 | issue = 3 | pages = 1392–403 |date=December 1996 | doi = 10.1016/S0022-3565(25)21300-3 | pmid = 8968364 | url = http://jpet.aspetjournals.org/cgi/pmidlookup?view=long&pmid=8968364| url-access = subscription }} However, it does reverse the prepulse inhibition deficits induced by apomorphine,{{cite journal |vauthors=Mansbach RS, Brooks EW, Sanner MA, Zorn SH | title = Selective dopamine D4 receptor antagonists reverse apomorphine-induced blockade of prepulse inhibition | journal = Psychopharmacology | volume = 135 | issue = 2 | pages = 194–200 |date=January 1998 | pmid = 9497025 | doi = 10.1007/s002130050501| s2cid = 9246828 | url = http://link.springer.de/link/service/journals/00213/bibs/8135002/81350194.htm| url-access = subscription }} and has also been shown to enhance cortical activity and inhibit stress-induced cognitive impairment.{{cite journal |vauthors=Rubinstein M, Cepeda C, Hurst RS, etal | title = Dopamine D4 receptor-deficient mice display cortical hyperexcitability | journal = Journal of Neuroscience | volume = 21 | issue = 11 | pages = 3756–63 |date=June 2001 | pmid = 11356863 | pmc = 6762699 | doi = 10.1523/JNEUROSCI.21-11-03756.2001| hdl = 11336/79333 }}{{cite journal |vauthors=Arnsten AF, Murphy B, Merchant K | title = The selective dopamine D4 receptor antagonist, PNU-101387G, prevents stress-induced cognitive deficits in monkeys | journal = Neuropsychopharmacology | volume = 23 | issue = 4 | pages = 405–10 |date=October 2000 | pmid = 10989267 | doi = 10.1016/S0893-133X(00)00133-0 | doi-access = free }} As a result, it was investigated as an antipsychotic for the treatment of schizophrenia in a placebo-controlled clinical trial, but in contrast to its comparator olanzapine no benefits were found and it was not researched further for this indication.{{cite journal |vauthors=Unangst PC, Capiris T, Connor DT, etal | title = Chromeno[3,4-c]pyridin-5-ones: selective human dopamine D4 receptor antagonists as potential antipsychotic agents | journal = Journal of Medicinal Chemistry | volume = 40 | issue = 17 | pages = 2688–93 |date=August 1997 | pmid = 9276014 | doi = 10.1021/jm970170v }}{{cite journal |vauthors=Corrigan MH, Gallen CC, Bonura ML, Merchant KM | title = Effectiveness of the selective D4 antagonist sonepiprazole in schizophrenia: a placebo-controlled trial | journal = Biological Psychiatry | volume = 55 | issue = 5 | pages = 445–51 |date=March 2004 | pmid = 15023570 | doi = 10.1016/j.biopsych.2003.10.004 | s2cid = 108634 }}

See also

References

{{Reflist}}

{{Dopaminergics}}

{{Piperazines}}

Category:Isochromenes

Category:Phenylpiperazines

Category:Sulfonamides