sophoradin

{{chembox

| Verifiedfields = changed

| Watchedfields = changed

| verifiedrevid = 426713434

| Name = Sophoradin

| ImageFile = Sophoradin.svg

| ImageSize = 200px

| ImageName = Chemical structure of sophoradin

| ImageAlt = Chemical structure of sophoradin

| PIN = 2′,4,4′-Trihydroxy-3,3′,5-tris(3-methylbut-2-en-1-yl)chalcone

| OtherNames =

|Section1={{Chembox Identifiers

| CASNo_Ref = {{cascite|correct|??}}

| CASNo = 23057-54-7

| CASNoOther =

| CASNo1_Ref = {{cascite|correct|CAS}}

| CASNo1 = 31934-68-6

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = GLR4RE4EBU

| PubChem = 5321393

| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}}

| ChemSpiderID = 4479146

| SMILES = O=C(c1ccc(O)c(c1O)C\C=C(/C)C)\C=C\c2cc(c(O)c(c2)C/C=C(\C)C)C\C=C(/C)C

| InChI = 1/C30H36O4/c1-19(2)7-11-23-17-22(18-24(29(23)33)12-8-20(3)4)10-15-27(31)26-14-16-28(32)25(30(26)34)13-9-21(5)6/h7-10,14-18,32-34H,11-13H2,1-6H3/b15-10+

| InChIKey = YAPAFDNQABLIIN-XNTDXEJSBZ

| StdInChI_Ref = {{stdinchicite|changed|chemspider}}

| StdInChI = 1S/C30H36O4/c1-19(2)7-11-23-17-22(18-24(29(23)33)12-8-20(3)4)10-15-27(31)26-14-16-28(32)25(30(26)34)13-9-21(5)6/h7-10,14-18,32-34H,11-13H2,1-6H3/b15-10+

| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}}

| StdInChIKey = YAPAFDNQABLIIN-XNTDXEJSSA-N

| MeSHName =

}}

|Section2={{Chembox Properties

| C=30|H=36|O=4

| Appearance =

| Density =

| MeltingPt =

| BoilingPt =

| Solubility =

}}

}}

Sophoradin is an isoprenyl chalconoid,[http://www.journalarchive.jst.go.jp/english/jnlabstract_en.php?cdjournal=bbb1961&cdvol=39&noissue=1&startpage=133 Synthesis of Isoprenyl Chalcone “Sophoradin” Isolated from Sophora subprostrata. Kazuaki Kyogoku, Katsuo Hatayama, Sadakazu Yokamori, Teruya Seki and Ichiro Tanaka, Agricultural and Biological Chemistry, Vol.39, No.1 (1975) pp.133-138] a type of polyphenolic compound, found in Sophora tonkinensis, an herb used in traditional Chinese medicine.

Sofalcone is an oral gastrointestinal medication and a synthetic analog of sophoradin.{{cite journal |vauthors=Konturek SJ, Mrzozowski T, Drozdowicz D, Pawlik W, Sendur R |title=Gastroprotective and ulcer healing effects of solon, a synthetic flavonoid derivative of sophoradin |journal=Hepatogastroenterology |volume=34 |issue=4 |pages=164–70 |date=August 1987 |pmid=3478294 }}