sorbitan tristearate
{{chembox
| Verifiedfields = changed
| Watchedfields = changed
| verifiedrevid = 350676682
| ImageFile=Sorbitan tristearate.png
| ImageSize=200px
| IUPACName= Octadecanoic acid [(2R,3S,4R)-2-[1,2-bis(1-oxooctadecoxy)ethyl]-4-hydroxy-3-tetrahydrofuranyl] ester
| OtherNames={{Unbulleted list
| Sorbitan trioctadecanoate
| E492
| Anhydrosorbitan tristearate
| Anhydrosorbitol tristearate
| Span 65
}}
|Section1={{Chembox Identifiers
| CASNo_Ref = {{cascite|correct|CAS}}
| CASNo=26658-19-5
| PubChem=62815
| EINECS =247-891-4
| UNII_Ref = {{fdacite|changed|FDA}}
| UNII = 6LUM696811
| SMILES=CCCCCCCCCCCCCCCCCC(=O)OCC([C@@H]1[C@H]([C@@H](CO1)O)OC(=O)CCCCCCCCCCCCCCCCC)OC(=O)CCCCCCCCCCCCCCCCC
| InChI=1/C60H114O8/c1-4-7-10-13-16-19-22-25-28-31-34-37-40-43-46-49-56(62)65-53-55(67-57(63)50-47-44-41-38-35-32-29-26-23-20-17-14-11-8-5-2)60-59(54(61)52-66-60)68-58(64)51-48-45-42-39-36-33-30-27-24-21-18-15-12-9-6-3/h54-55,59-61H,4-53H2,1-3H3/t54-,55?,59+,60-/m1/s1
}}
|Section2={{Chembox Properties
| Formula=C60H114O8
| MolarMass=963.54 g/mol
| Appearance=Waxy solid
| Density=
| MeltingPt=
| BoilingPt=
| Solubility=
}}
|Section3={{Chembox Hazards
| MainHazards=
| FlashPt=
| AutoignitionPt =
}}
}}
Sorbitan tristearate is a nonionic surfactant. It is variously used as a dispersing agent, emulsifier, and stabilizer, in food and in aerosol sprays. As a food additive, it has the E number E492. Brand names for polysorbates include Alkest, Canarcel, and Span. The consistency of sorbitan tristearate is waxy; its color is light cream to tan.
See also
- Sorbitan monostearate (Span 60)