spinasterol
{{Chembox
| Name=α-Spinasterol
| ImageFile = alpha-spinasterol.svg
| ImageSize = 200px
| IUPACName = (22E)-5α-Stigmasta-7,22-dien-3β-ol
| SystematicName = (1R,3aR,5aS,7S,9aS,9bR,11aR)-1-[(2R,3E,5S)-5-Ethyl-6-methylhept-3-en-2-yl]-9a,11a-dimethyl-2,3,3a,5,5a,6,7,8,9,9a,9b,10,11,11a-tetradecahydro-1H-cyclopenta[a]phenanthren-7-ol
| OtherNames = α-Spinasterin; Bessisterol; Hitodesterol
|Section1={{Chembox Identifiers
| CASNo = 481-18-5
| CASNo_Ref = {{cascite|correct|CAS}}
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = 0LG993QX1A
| PubChem = 5281331
| ChemSpiderID = 4444708
| SMILES = O[C@H]1CC[C@@]2([C@@H]3\C(=C/C[C@H]2C1)[C@@H]4CC[C@H]([C@@H](/C=C/[C@@H](CC)C(C)C)C)[C@]4(CC3)C)C
| InChI = 1/C29H48O/c1-7-21(19(2)3)9-8-20(4)25-12-13-26-24-11-10-22-18-23(30)14-16-28(22,5)27(24)15-17-29(25,26)6/h8-9,11,19-23,25-27,30H,7,10,12-18H2,1-6H3/b9-8+/t20-,21-,22+,23+,25-,26+,27+,28+,29-/m1/s1
| InChIKey = JZVFJDZBLUFKCA-FXIAWGAOBQ
| StdInChI = 1S/C29H48O/c1-7-21(19(2)3)9-8-20(4)25-12-13-26-24-11-10-22-18-23(30)14-16-28(22,5)27(24)15-17-29(25,26)6/h8-9,11,19-23,25-27,30H,7,10,12-18H2,1-6H3/b9-8+/t20-,21-,22+,23+,25-,26+,27+,28+,29-/m1/s1
| StdInChIKey = JZVFJDZBLUFKCA-FXIAWGAOSA-N
}}
|Section2={{Chembox Properties
| C=29|H=48|O=1
| Appearance = Crystalline solidMerck Index, 11th Edition, 8705
| Density =
| MeltingPtC = 168 to 169
| BoilingPt =
| Solubility =
}}
|Section3={{Chembox Hazards
| MainHazards =
| FlashPt =
| AutoignitionPt =
}}
}}
α-Spinasterol is a stigmastane-type phytosterol found in a variety of plant sources such as spinach,{{cite journal |title=Spinasterol and Some of Its Esters |journal=The Journal of Biological Chemistry |year=1932 |volume=95 |pages=311–5 |first1=Merrill C. |last1=Hart |first2=Frederick W. |last2=Heyl | url = http://www.jbc.org/content/95/1/311.citation |issue=1|doi=10.1016/S0021-9258(18)76377-1 |doi-access=free }} from which it gets its name.
The chemical was recently found in Gordonia ceylanica, the first time that this chemical was found in the Gordonia species.{{citation needed|date=January 2015}}
See also
- Chondrillasterol 24R isomer
- Stigmasterol 5,22-dien isomer
References
{{reflist}}
Further reading
- {{cite journal |vauthors=Herath HM, Athukoralage PS, Jamie JF |title=A new oleanane triterpenoid from Gordonia ceylanica |journal=Natural Product Letters |volume=15 |issue=5 |pages=339–44 |year=2001 |pmid=11841118 |doi=10.1080/10575630108041301|s2cid=28253042 }}
{{Phytosterols}}
{{steroid-stub}}