spinetoram
{{Short description|Chemical compound}}
{{Drugbox
| drug_name =
| type =
| IUPAC_name = (2R,5R,9R,10S,14R,15S,19S)-15-[(2R,5S,6R)-5-(dimethylamino)-6-methyloxan-2-yl]oxy-7-[(2R,3R,4R,5S,6S)-4-ethoxy-3,5-dimethoxy-6-methyloxan-2-yl]oxy-19-ethyl-14-methyl-20-oxatetracyclo[10.10.0.02,10.05,9]docos-11-ene-13,21-dione
| image = Spinetoram-j.svg
| width = 240
| image2 = Spinetoram-l.svg
| width2 = 240
| pronounce =
| tradename = Delegate, Cheristin
| Drugs.com =
| MedlinePlus =
| licence_CA =
| licence_EU =
| DailyMedID =
| licence_US =
| pregnancy_AU =
| pregnancy_AU_comment =
| pregnancy_category =
| dependency_liability =
| addiction_liability =
| routes_of_administration =
| class =
| ATCvet = Yes
| ATC_prefix = P53
| ATC_suffix = AX31
| ATC_supplemental =
| biosimilars =
| CAS_number_Ref = {{cascite|correct|CAS}}
| CAS_number = 935545-74-7
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = YGZ1037ELN
| PubChem = 53297414
| DrugBank =
| ChemSpiderID = 30791336
| synonyms =
| C = 42
| H = 69
| N = 1
| O = 10
| smiles = CCC1CCCC(C(C(=O)C2=CC3C(C2CC(=O)O1)CCC4C3CC(C4)OC5C(C(C(C(O5)C)OC)OCC)OC)C)OC6CCC(C(O6)C)N(C)C
| StdInChI = InChI=1S/C42H69NO10/c1-10-27-13-12-14-35(53-37-18-17-34(43(6)7)24(4)49-37)23(3)38(45)33-21-31-29(32(33)22-36(44)51-27)16-15-26-19-28(20-30(26)31)52-42-41(47-9)40(48-11-2)39(46-8)25(5)50-42/h21,23-32,34-35,37,39-42H,10-20,22H2,1-9H3/t23-,24-,25+,26-,27+,28?,29-,30-,31-,32?,34+,35+,37+,39+,40-,41-,42+/m1/s1
| StdInChIKey = GOENIMGKWNZVDA-OAMCMWGQSA-N
| StdInChI_Ref = {{stdinchicite|correct|chemspider}}
}}
Spinetoram (marketed as Cheristin in its topical veterinary dosage-form) is an insecticidal mixture of two active neurotoxic constituents of Saccharopolyspora spinosa.{{Cite journal| vauthors = Bacci L, Lupi D, Savoldelli S, Rossaro B |date=2016-04-28|title=A review of Spinosyns, a derivative of biological acting substances as a class of insecticides with a broad range of action against many insect pests|url=http://www.pagepressjournals.org/index.php/jear/article/view/5653|journal=Journal of Entomological and Acarological Research|volume=48|issue=1|pages=40|doi=10.4081/jear.2016.5653|issn=2279-7084|doi-access=free|hdl=2434/380778|hdl-access=free}} It is used to control pest insects in stored grain{{Cite journal| vauthors = Vassilakos TN, Athanassiou CG, Tsiropoulos NG |date=2015|title=Influence of grain type on the efficacy of spinetoram for the control of Rhyzopertha dominica, Sitophilus granarius and Sitophilus oryzae |journal=Journal of Stored Products Research|language=en|volume=64|pages=1–7|doi=10.1016/j.jspr.2015.02.002}} and on domestic cats.{{cite journal | vauthors = Paarlberg T, Winkle J, Rumschlag AJ, Young LM, Ryan WG, Snyder DE | title = ®) for cats | journal = Parasites & Vectors | volume = 10 | issue = 1 | pages = 59 | date = February 2017 | pmid = 28148275 | pmc = 5288883 | doi = 10.1186/s13071-017-1996-9 | doi-access = free }}