spirodiclofen

{{Short description|Insecticide}}

{{Chembox

| ImageFile = Spirodiclofen Structural Formula V.1.svg

| ImageSize = 200px

| ImageAlt =

| PIN = 3-(2,4-Dichlorophenyl)-2-oxo-1-oxaspiro[4.5]non-3-en-4-yl 2,2-dimethylbutanoate

| OtherNames =

| Section1 = {{Chembox Identifiers

| CASNo = 148477-71-8

| CASNo_Ref = {{cascite|correct|CAS}}

| ChEBI = 38639

| ChEMBL = 2227839

| EC_number = 604-636-5

| KEGG = C18553

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = 3X7G31F5MX

| PubChem = 177863

| ChemSpiderID =17215909

| SMILES = CCC(C)(C)C(=O)OC1=C(C(=O)OC12CCCCC2)c3cc(cc(c3)Cl)Cl

| StdInChI=1S/C21H24Cl2O4/c1-4-20(2,3)19(25)26-17-16(13-10-14(22)12-15(23)11-13)18(24)27-21(17)8-6-5-7-9-21/h10-12H,4-9H2,1-3H3

| StdInChIKey = OYNVHVAEOLJJPV-UHFFFAOYSA-N

}}

| Section2 = {{Chembox Properties

| C=21|H=24|Cl=2|O=4

| Appearance = White solid

| Density =

| MeltingPtC = 94.8

| MeltingPt_ref =

| BoilingPt =

| Solubility =

}}

| Section3 = {{Chembox Hazards

| MainHazards =

| FlashPt =

| AutoignitionPt =

| GHSPictograms = {{GHS07}}{{GHS08}}{{GHS09}}

| GHSSignalWord = Danger

| HPhrases = {{H-phrases|317|350|361|373|410}}

| PPhrases = {{P-phrases|201|202|260|261|272|273|280|281|302+352|308+313|314|321|333+313|363|391|405|501}}

}}

}}

Spirodiclofen is an acaricide and insecticide used in agriculture to control mites and San Jose scale. In the United States, it is used on citrus, grapes, pome fruit, stone fruit, and tree nut crops.{{Cite web | url = https://www3.epa.gov/pesticides/chem_search/reg_actions/registration/fs_PC-124871_11-Aug-05.pdf | publisher = Environmental Protection Agency | title = EPA Pesticide Fact Sheet: Spirodiclofen }}{{Cite web | url = http://www.fao.org/fileadmin/templates/agphome/documents/Pests_Pesticides/JMPR/Evaluation09/Spirodiclofen.pdf | title = Spirodiclofen | publisher = Food and Agricultural Organization of the United Nations}}{{Cite book |last=Jeschke |first=Peter |url=https://onlinelibrary.wiley.com/doi/book/10.1002/9783527699261 |title=Modern Crop Protection Compounds |last2=Witschel |first2=Matthias |last3=Krämer |first3=Wolfgang |last4=Schirmer |first4=Ulrich |date=25 January 2019 |publisher=Wiley‐VCH |isbn=9783527699261 |edition=3rd |pages=1202–1222 |chapter=32.4 Inhibitors of Lipid Synthesis: Acetyl‐CoA Carboxylase Inhibitors.}}

Spirodiclofen belongs to the tetronic acid class and acts by inhibiting lipid biosynthesis, specifically acetyl CoA carboxylase, and is in IRAC group 23.{{cite journal | pmid=20218531| year=2009| last1=De Maeyer| first1=L| title=The multiple target use of spirodiclofen (Envidor 240 SC) in IPM pomefruit in Belgium| journal=Communications in Agricultural and Applied Biological Sciences| volume=74| issue=1| pages=225–32| last2=Geerinck| first2=R}}

References