sterubin

{{chembox

| Verifiedfields = changed

| Watchedfields = changed

| verifiedrevid = 470470833

| ImageFile = Sterubin.png

| ImageSize = 200px

| IUPACName = (2S)-3′,4′,5-Trihydroxy-7-methoxyflavan-4-one

| SystematicName = (2S)-2-(3,4-Dihydroxyphenyl)-5-hydroxy-7-methoxy-2,3-dihydro-4H-1-benzopyran-4-one

| OtherNames = 7-Methoxy-3′,4′,5-trihydroxyflavanone

|Section1={{Chembox Identifiers

| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}

| ChemSpiderID = 1064932

| InChI = 1/C16H14O6/c1-21-9-5-12(19)16-13(20)7-14(22-15(16)6-9)8-2-3-10(17)11(18)4-8/h2-6,14,17-19H,7H2,1H3/t14-/m0/s1

| InChIKey = DSAJORLEPQBKDA-AWEZNQCLBS

| StdInChI_Ref = {{stdinchicite|correct|chemspider}}

| StdInChI = 1S/C16H14O6/c1-21-9-5-12(19)16-13(20)7-14(22-15(16)6-9)8-2-3-10(17)11(18)4-8/h2-6,14,17-19H,7H2,1H3/t14-/m0/s1

| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}

| StdInChIKey = DSAJORLEPQBKDA-AWEZNQCLSA-N

| CASNo_Ref = {{cascite|correct|CAS}}

| CASNo = 51857-11-5

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = 0IT00NY6AC

| PubChem = 1268276

| SMILES = O=C2c3c(O[C@H](c1ccc(O)c(O)c1)C2)cc(OC)cc3O

}}

|Section2={{Chembox Properties

| Formula = C₁₆H₁₄O₆

| MolarMass = 302.28 g/mol

| Appearance =

| Density = 1.458 g/mL

| MeltingPt =

| BoilingPt =

| Solubility = }}

|Section3={{Chembox Hazards

| MainHazards =

| FlashPt =

| AutoignitionPt = }}

}}

Sterubin (7-methoxy-3',4',5-trihydroxyflavanone) is a bitter-masking flavanone extracted from Yerba Santa (Eriodictyon californicum) a plant growing in America.Patricia Kaminski and Richard Katz. [http://www.flowersociety.org/Yerba_About.htm Yerba Santa Eriodictyon californicum]. Flower Essence Society.

Sterubin is one of the four flavanones identified by Symrise in this plant which elicit taste-modifying properties. The others are homoeriodictyol, its sodium salt, and eriodictyol.{{cite journal |vauthors=Ley JP, Krammer G, Reinders G, Gatfield IL, Bertram HJ |title=Evaluation of bitter masking flavanones from Herba Santa (Eriodictyon californicum (H. and A.) Torr., Hydrophyllaceae) |journal=J. Agric. Food Chem. |volume=53 |issue=15 |pages=6061–6 |date=July 2005 |pmid=16028996 |doi=10.1021/jf0505170 }}

Recent research has demonstrated some neuroprotective properties of Sterubin in vitro, but more research is needed before it can be considered a true drug candidate.{{cite journal |author1=Wolfgang Fischer |author2=Antonio Currais |author3=Zhibin Liang |author4=Antonio Pinto |author5=Pamela Maher |title=Old age-associated phenotypic screening for Alzheimer's disease drug candidates identifies sterubin as a potent neuroprotective compound from Yerba santa |journal=Redox Biology |volume=21 |date=February 2019 |page=101089 |pmid=30594901 |doi=10.1016/j.redox.2018.101089 |pmc=6309122 }}{{cite journal |author1=Zhibin Liang |author2=Pamela Maher |title=Structural Requirements for the Neuroprotective and Anti-Inflammatory Activities of the Flavanone Sterubin |journal=Antioxidants |volume=11 |date=November 2022 |issue=11 |page=2197 |pmid=36358569 |pmc=9686938 |doi=10.3390/antiox11112197 |doi-access=free }}Batya Swift Yasgur. [https://www.medscape.com/viewarticle/909499]. (Paywalled) Medscape. February 2019.