strictamine

{{Chembox

| ImageFile = Strictamine.svg

| ImageSize = 150px

| ImageAlt =

| IUPACName = methyl (10S,12R,13E,18S)-13-Ethylidene-8,15-diazapentacyclo[10.5.1.01,9.02,7.010,15]octadeca-2,4,6,8-tetraene-18-carboxylate

| OtherNames = Desacetyldesformoakuammiline; Vincamidine

|Section1={{Chembox Identifiers

| CASNo = 6475-05-4

| PubChem = 6444325

| ChemSpiderID = 21270082

| StdInChI=1S/C20H22N2O2/c1-3-12-11-22-9-8-20-14-6-4-5-7-15(14)21-18(20)16(22)10-13(12)17(20)19(23)24-2/h3-7,13,16-17H,8-11H2,1-2H3/b12-3-/t13-,16-,17+,20?/m0/s1

| StdInChIKey = LITYYRLWHAQJQS-PHDDPKRUSA-N

| SMILES = C/C=C\1/CN2CCC34[C@H]([C@H]1C[C@H]2C3=NC5=CC=CC=C45)C(=O)OC}}

|Section2={{Chembox Properties

| C=20|H=22|N=2|O=2

| Appearance =

| Density =

| MeltingPt =

| BoilingPt =

| Solubility = }}

|Section3={{Chembox Hazards

| MainHazards =

| FlashPt =

| AutoignitionPt = }}

}}

Strictamine is an alkaloid isolated from Alstonia scholaris.{{cite journal | pmid = 500142 | year = 1979 | last1 = Bhattacharya | first1 = S. K. | title = Neuropharmacological studies on strictamine isolated from Alstonia scholaris | journal = Indian Journal of Experimental Biology | volume = 17 | issue = 6 | pages = 598–600 | last2 = Bose | first2 = R. | last3 = Dutta | first3 = S. C. | last4 = Ray | first4 = A. B. | last5 = Guha | first5 = S. R. }}

Because of its unusual chemical structure, it has attracted research interest and several laboratory syntheses have been reported.{{Cite journal | doi = 10.1021/acs.orglett.6b03839 | pmid = 28253628 | title = A 7-Step Formal Asymmetric Total Synthesis of Strictamine via an Asymmetric Propargylation and Metal-Mediated Cyclization | journal = Organic Letters | volume = 19 | issue = 5 | pages = 1004–1007 | year = 2017 | last1 = Smith | first1 = Myles W. | last2 = Zhou | first2 = Zhiyao | last3 = Gao | first3 = Alison X. | last4 = Shimbayashi | first4 = Takuya | last5 = Snyder | first5 = Scott A. }}{{Cite journal | doi = 10.1002/anie.201901074| pmid = 30775833| title = Asymmetric Total Syntheses of the Akuammiline Alkaloids (−)-Strictamine and (−)-Rhazinoline| journal = Angewandte Chemie International Edition| volume = 58| issue = 18| pages = 6059–6063| year = 2019| last1 = Li| first1 = Wenfei| last2 = Chen| first2 = Zhitao| last3 = Yu| first3 = Di| last4 = Peng| first4 = Xin| last5 = Wen| first5 = Guohua| last6 = Wang| first6 = Siqi| last7 = Xue| first7 = Fei| last8 = Liu| first8 = Xiao-Yu| last9 = Qin| first9 = Yong| s2cid = 73472189}}{{Cite journal | doi = 10.1021/jacs.5b12880| pmid = 26783944| pmc = 5154302| title = Enantioselective Total Syntheses of Akuammiline Alkaloids (+)-Strictamine, (−)-2(S)-Cathafoline, and (−)-Aspidophylline A| journal = Journal of the American Chemical Society| volume = 138| issue = 4| pages = 1162–1165| year = 2016| last1 = Moreno| first1 = Jesus| last2 = Picazo| first2 = Elias| last3 = Morrill| first3 = Lucas A.| last4 = Smith| first4 = Joel M.| last5 = Garg| first5 = Neil K.}}{{Cite journal | doi = 10.1039/C7CC08153G| pmid = 29167841| title = Formal total synthesis of the akuammiline alkaloid (+)-strictamine| journal = Chemical Communications| volume = 53| issue = 94| pages = 12665–12667| year = 2017| last1 = Xiao| first1 = Tao| last2 = Chen| first2 = Zhi-Tao| last3 = Deng| first3 = Lin-Feng| last4 = Zhang| first4 = Dan| last5 = Liu| first5 = Xiao-Yu| last6 = Song| first6 = Hao| last7 = Qin| first7 = Yong}}

References