strontium bromate

{{One source|date=November 2024}}

{{chembox

| verifiedrevid =

| Name = Strontium bromate

| ImageFile =

| ImageSize =

| ImageName =

| IUPACName = Strontium dibromate

| OtherNames =

|Section1={{Chembox Identifiers

| SMILES = [O-]Br(=O)=O.[O-]Br(=O)=O.[Sr+2]

| CASNo = 14519-18-7

| CASNo_Ref = {{cascite|correct|CAS}}

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = 1T54WJB20V

| RTECS =

| PubChem = 9819472

| EINECS = 238-531-7

| InChI = 1S/2BrHO3.Sr/c2*2-1(3)4;/h2*(H,2,3,4);/q;;+2/p-2

}}

|Section2={{Chembox Properties

| Formula = SrBr2O6

| MolarMass = 343.424 g/mol

| Density =

| Solubility = 27.2 g/100 mL

| MeltingPtC = 240

| MeltingPt_notes = (decomposes)

| BoilingPt =

| pKa =

| pKb =

| Appearance =

| MagSus = −93.5·10−6 cm3/mol

}}

|Section3={{Chembox Structure

| CrystalStruct =

}}

|Section7={{Chembox Hazards

| ExternalSDS =

| MainHazards =

}}

|Section8={{Chembox Related

| OtherCations = calcium bromate
barium bromate

| OtherCompounds =

}}

}}

Strontium bromate is a rarely considered chemical in the laboratory or in industries. It is, however, mentioned in the book Uncle Tungsten: Memories of a Chemical Boyhood by Oliver Sacks. There it is said that this salt glows when crystallized from a saturated aqueous solution.{{cite book | title = Uncle Tungsten: Memories of a Chemical Boyhood | author = Oliver Sacks | date = 2002 | edition = First Vintage Books | page = 230 }} Chemically this salt is soluble in water, and is a moderately strong oxidizing agent.{{cite web|title=Strontium Bromate|url=http://www.americanelements.com/srbrat.html|publisher=American Elements|accessdate=25 July 2013}}{{fv|date=November 2024}}

Strontium bromate is toxic if ingested and irritates the skin and respiratory tract if come into contact with or inhaled, respectively. Its chemical formula is Sr(BrO3)2.

References

{{inorganic-compound-stub}}

{{Strontium compounds}}

{{Bromates}}

Category:Strontium compounds

Category:Bromates

Category:Inorganic compounds

Category:Oxidizing agents