sulconazole

{{Short description|Chemical compound}}

{{Drugbox

| Verifiedfields = changed

| Watchedfields = changed

| verifiedrevid = 470472797

| IUPAC_name = 1-(2-{[(4-Chlorophenyl)methyl]sulfanyl}-2-(2,4-dichlorophenyl)ethyl)-1H-imidazole

| image = Sulconazole.svg

| tradename = Exelderm

| Drugs.com = {{drugs.com|monograph|exelderm}}

| MedlinePlus = a698018

| pregnancy_category =

| legal_status =

| routes_of_administration = Topical

| bioavailability =

| metabolism =

| excretion =

| CAS_number_Ref = {{cascite|changed|??}}

| CAS_number = 61318-90-9

| ATC_prefix = D01

| ATC_suffix = AC09

| PubChem = 5318

| DrugBank= DB06820

| DrugBank_Ref = {{drugbankcite|correct|drugbank}}

| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}

| ChemSpiderID = 5127

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = 5D9HAA5Q5S

| KEGG_Ref = {{keggcite|correct|kegg}}

| KEGG = D08535

| ChEBI_Ref = {{ebicite|changed|EBI}}

| ChEBI = 9325

| ChEMBL_Ref = {{ebicite|correct|EBI}}

| ChEMBL = 1221

| C=18 | H=15 | Cl=3 | N=2 | S=1

| smiles = Clc1ccc(c(Cl)c1)C(SCc2ccc(Cl)cc2)Cn3ccnc3

| StdInChI_Ref = {{stdinchicite|correct|chemspider}}

| StdInChI = 1S/C18H15Cl3N2S/c19-14-3-1-13(2-4-14)11-24-18(10-23-8-7-22-12-23)16-6-5-15(20)9-17(16)21/h1-9,12,18H,10-11H2

| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}

| StdInChIKey = AFNXATANNDIXLG-UHFFFAOYSA-N

}}

Sulconazole (trade name Exelderm) is an antifungal medication of the imidazole class. It is available as a cream or solution to treat skin infections such as athlete's foot, ringworm, jock itch, and tinea versicolor.Drugs.com: [https://www.drugs.com/mtm/sulconazole-topical.html sulconazole topical]{{cite journal | vauthors = Fromtling RA | title = Overview of medically important antifungal azole derivatives | journal = Clinical Microbiology Reviews | volume = 1 | issue = 2 | pages = 187–217 | date = April 1988 | pmid = 3069196 | pmc = 358042 | doi = 10.1128/CMR.1.2.187 }} Although not used commercially for insect control, sulconazole nitrate exhibits a strong anti-feeding effect on the keratin-digesting Australian carpet beetle larvae Anthrenocerus australis.{{cite journal | vauthors = Sunderland MR, Cruickshank RH, Leighs SJ | year = 2014 | title = The efficacy of antifungal azole and antiprotozoal compounds in protection of wool from keratin-digesting insect larvae | journal = Textile Research Journal | volume = 84 | issue = 9| pages = 924–931 | doi=10.1177/0040517513515312| s2cid = 135799368 }}