sulfamethoxypyridazine

{{Short description|Chemical compound}}

{{refimprove|date=June 2021}}

{{Drugbox

| Verifiedfields = changed

| verifiedrevid = 470473115

| IUPAC_name = 4-amino-N-(6-methoxypyridazin-3-yl)benzenesulfonamide

| image = Sulfamethoxypyridazine.png

| tradename =

| Drugs.com = {{drugs.com|international|sulfamethoxypyridazine}}

| pregnancy_AU =

| pregnancy_US =

| pregnancy_category =

| legal_AU =

| legal_CA =

| legal_UK =

| legal_US =

| legal_status =

| routes_of_administration =

| bioavailability =

| protein_bound =

| metabolism =

| elimination_half-life =

| excretion =

| CAS_number_Ref = {{cascite|changed|??}}

| CAS_number = 80-35-3

| ATC_prefix = J01

| ATC_suffix = ED05

| ATC_supplemental = {{ATCvet|J01|EQ15}}

| PubChem = 5330

| DrugBank_Ref = {{drugbankcite|correct|drugbank}}

| DrugBank =

| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}

| ChemSpiderID = 5139

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = T034E4NS2Z

| KEGG_Ref = {{keggcite|correct|kegg}}

| KEGG = D02439

| ChEBI_Ref = {{ebicite|correct|EBI}}

| ChEBI = 102516

| ChEMBL_Ref = {{ebicite|correct|EBI}}

| ChEMBL = 268869

| C=11 | H=12 | N=4 | O=3 | S=1

| smiles = O=S(=O)(Nc1nnc(OC)cc1)c2ccc(N)cc2

| StdInChI_Ref = {{stdinchicite|correct|chemspider}}

| StdInChI = 1S/C11H12N4O3S/c1-18-11-7-6-10(13-14-11)15-19(16,17)9-4-2-8(12)3-5-9/h2-7H,12H2,1H3,(H,13,15)

| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}

| StdInChIKey = VLYWMPOKSSWJAL-UHFFFAOYSA-N

}}

Sulfamethoxypyridazine is a sulfonamide antibacterial.{{cite journal | vauthors = Boger WP, Gylfe JM, Strickland CS | title = Sulfamethoxypyridazine (Kynex), a new long-acting sulfonamide | journal = Antibiotic Medicine & Clinical Therapy | location = New York, NY | volume = 3 | issue = 6 | pages = 378–87 | date = November 1956 | pmid = 13363378 | doi = | url = }}

It is prescribed for vaginal irritation, and severe acute thrush.

It is also used in the treatment of Dermatitis herpetiformis,{{cite journal | vauthors = Vilanova X, De Moragas JM | title = [Treatment of dermatitis herpetiformis (Duhring) and herpes gestationis with sulfamethoxypyridazine] | language=es| journal = Actas Dermo-sifiliograficas | volume = 50 | issue = | pages = 439–42 | date = October 1959 | pmid = 13842251 | doi = | url = }} where it is an alternative therapy to Dapsone.

Sulfamethoxypyridazine is supplied as 500mg tablets.