sulfamoxole

{{cs1 config|name-list-style=vanc}}

{{Short description|Chemical compound}}

{{Drugbox

| Watchedfields = changed

| verifiedrevid = 443224883

| IUPAC_name = 4-amino-N-(4,5-dimethyl-1,3-oxazol-2-yl)benzenesulfonamide

| image = Sulfamoxole.png

| tradename =

| pregnancy_AU =

| pregnancy_US =

| pregnancy_category =

| legal_AU =

| legal_CA =

| legal_UK =

| legal_US =

| legal_status =

| routes_of_administration =

| bioavailability =

| protein_bound =

| metabolism =

| elimination_half-life =

| excretion =

| CAS_number = 729-99-7

| ATC_prefix = J01

| ATC_suffix = EC03

| PubChem = 12894

| DrugBank_Ref = {{drugbankcite|correct|drugbank}}

| DrugBank = DB08798

| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}

| ChemSpiderID = 12361

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = HGG82XE020

| KEGG_Ref = {{keggcite|correct|kegg}}

| KEGG = D02516

| ChEBI_Ref = {{ebicite|correct|EBI}}

| ChEBI = 55548

| C=11 | H=13 | N=3 | O=3 | S=1

| smiles = O=S(=O)(Nc1nc(c(o1)C)C)c2ccc(N)cc2

| StdInChI_Ref = {{stdinchicite|correct|chemspider}}

| StdInChI = 1S/C11H13N3O3S/c1-7-8(2)17-11(13-7)14-18(15,16)10-5-3-9(12)4-6-10/h3-6H,12H2,1-2H3,(H,13,14)

| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}

| StdInChIKey = CYFLXLSBHQBMFT-UHFFFAOYSA-N

}}

Sulfamoxole is a sulfonamide antibacterial.{{cite journal | vauthors = Dugger JA | title = Sulfamoxole (Nuprin), a new sulfonamide, in pediatric practice | journal = The Journal of New Drugs | volume = 1 | issue = 5| pages = 223–9 | date = 1961 | pmid = 13888264 | doi = 10.1177/009127006100100506 }}