sulforidazine

{{Short description|Typical antipsychotic medication}}

{{cs1 config|name-list-style=vanc|display-authors=6}}

{{Drugbox

| Verifiedfields = changed

| Watchedfields = changed

| verifiedrevid = 470473917

| image = Sulforidazine.svg

| width = 200

| image2 = Sulforidazine3d.png

| width2 = 180

| tradename =

| pregnancy_category =

| legal_status =

| routes_of_administration =

| bioavailability =

| metabolism =

| excretion =

| CAS_number_Ref = {{cascite|changed|??}}

| CAS_number = 14759-06-9

| ATC_prefix = none

| PubChem = 31765

| DrugBank_Ref = {{drugbankcite|correct|drugbank}}

| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}

| ChemSpiderID = 29458

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = B7599I244X

| ChEBI = 135644

| ChEMBL = 2107268

| IUPAC_name = 10-{2-[(RS)-1-Methylpiperidin-2-yl]ethyl}-2-(methylsulfonyl)-10H-phenothiazine

| C=21 | H=26 | N=2 | O=2 | S=2

| smiles = O=S(=O)(c2cc1N(c3c(Sc1cc2)cccc3)CCC4N(C)CCCC4)C

| StdInChI_Ref = {{stdinchicite|correct|chemspider}}

| StdInChI = 1S/C21H26N2O2S2/c1-22-13-6-5-7-16(22)12-14-23-18-8-3-4-9-20(18)26-21-11-10-17(15-19(21)23)27(2,24)25/h3-4,8-11,15-16H,5-7,12-14H2,1-2H3

| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}

| StdInChIKey = FLGCRGJDQJIJAW-UHFFFAOYSA-N

}}

Sulforidazine (Imagotan, Psychoson, Inofal) a typical antipsychotic and a metabolite of thioridazine; it and mesoridazine are more potent than the parent compound, whose pharmacological effects are believed by some to be largely due to its metabolism into sulforidazine and mesoridazine.{{cite journal | vauthors = Niedzwiecki DM, Mailman RB, Cubeddu LX | title = Greater potency of mesoridazine and sulforidazine compared with the parent compound, thioridazine, on striatal dopamine autoreceptors | journal = The Journal of Pharmacology and Experimental Therapeutics | volume = 228 | issue = 3 | pages = 636–639 | date = March 1984 | pmid = 6707914 | doi = 10.1016/S0022-3565(25)21884-5 }}