sulprostone
{{Short description|Chemical compound}}
{{Drugbox
| Verifiedfields = changed
| Watchedfields = changed
| verifiedrevid = 458942413
| IUPAC_name = (Z)-7-[(1R,3R)-3-hydroxy-2-[(E,3R)-3-hydroxy-4-phenoxybut-1-enyl]-5-oxocyclopentyl]-N-methylsulfonylhept-5-enamide
| image = Sulprostone.png
| tradename =
| Drugs.com = {{drugs.com|international|sulprostone}}
| pregnancy_AU =
| pregnancy_US =
| legal_AU =
| legal_CA =
| legal_UK =
| legal_US =
| CAS_number_Ref = {{cascite|changed|??}}
| CAS_number = 60325-46-4
| ATC_prefix = G02
| ATC_suffix = AD05
| PubChem = 5312153
| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}}
| ChemSpiderID = 4471583
| DrugBank_Ref = {{drugbankcite|correct|drugbank}}
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = 501Q5EQ1GM
| KEGG_Ref = {{keggcite|correct|kegg}}
| KEGG = D02725
| ChEMBL_Ref = {{ebicite|changed|EBI}}
| ChEMBL = 284178
| smiles = CS(=O)(=O)NC(=O)CCC/C=C\C[C@@H]1[C@H]([C@@H](CC1=O)O)/C=C/[C@H](COc2ccccc2)O
| StdInChI_Ref = {{stdinchicite|changed|chemspider}}
| StdInChI = 1S/C23H31NO7S/c1-32(29,30)24-23(28)12-8-3-2-7-11-19-20(22(27)15-21(19)26)14-13-17(25)16-31-18-9-5-4-6-10-18/h2,4-7,9-10,13-14,17,19-20,22,25,27H,3,8,11-12,15-16H2,1H3,(H,24,28)/b7-2-,14-13+/t17-,19-,20-,22-/m1/s1
| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}}
| StdInChIKey = UQZVCDCIMBLVNR-TWYODKAFSA-N
| C=23 | H=31 | N=1 | O=7 | S=1
}}
Sulprostone is an analogue of prostaglandin E2 (PGE2) that has oxytocic activity in assays of rat kidney cells and tissues.{{Cite journal |vauthors=Tamma G, Wiesner B, Furkert J, etal |title=The prostaglandin E2 analogue sulprostone antagonizes vasopressin-induced antidiuresis through activation of Rho |journal=Journal of Cell Science |volume=116 |issue=Pt 16 |pages=3285–94 |date=August 2003 |pmid=12829746 |doi=10.1242/jcs.00640 |hdl=11586/43242 |url=http://jcs.biologists.org/cgi/pmidlookup?view=long&pmid=12829746|doi-access=free |url-access=subscription }} There are four known receptors which mediate various but often different cellular and tissue responses to PGE2: prostaglandin EP1 receptor, prostaglandin EP2 receptor, prostaglandin EP3 receptor, and prostaglandin EP4 receptor. Sulprosotone binds to and activates the prostaglandin EP3 receptor with far greater efficacy than the other PGE2 receptors and also has the advantage of being relatively resistant, compared with PGE2, to becoming metabolically degraded. It is listed as a comparatively weak receptor agonist of the prostaglandin EP1 receptor. In all events, this as well as other potent synthetic EP3 receptor antagonists have the realized or potential ability to promote the beneficial effects of prostaglandin EP3 receptor activation.{{cite journal | vauthors = Moreno JJ | title = Eicosanoid receptors: Targets for the treatment of disrupted intestinal epithelial homeostasis | journal = European Journal of Pharmacology | volume = 796 | pages = 7–19 | year = 2017 | pmid = 27940058 | doi = 10.1016/j.ejphar.2016.12.004 | s2cid = 1513449 }}
Sulprostone (as well as other prostanoids receptor agonists) is in use for inducing medical abortion and ending pregnancy after fetal death,{{cite journal | vauthors = Van Mensel K, Claerhout F, Debois P, Keirse MJ, Hanssens M | title = A randomized controlled trial of misoprostol and sulprostone to end pregnancy after fetal death | journal = Obstetrics and Gynecology International | volume = 2009 | pages = 496320 | year = 2009 | pmid = 19960062 | pmc = 2778817 | doi = 10.1155/2009/496320 | doi-access = free }} for the treatment of severe atonic postpartum hemorrhage after vaginal delivery,{{cite journal | vauthors = Schmitz T, Tararbit K, Dupont C, Rudigoz RC, Bouvier-Colle MH, Deneux-Tharaux C | title = Prostaglandin E2 analogue sulprostone for treatment of atonic postpartum hemorrhage | journal = Obstetrics and Gynecology | volume = 118 | issue = 2 Pt 1 | pages = 257–65 | year = 2011 | pmid = 21775840 | doi = 10.1097/AOG.0b013e3182255335 | s2cid = 11989341 }} and for removal of the placenta in patients with retained placenta.{{cite journal | vauthors = Grillo-Ardila CF, Ruiz-Parra AI, Gaitán HG, Rodriguez-Malagon N | title = Prostaglandins for management of retained placenta | journal = The Cochrane Database of Systematic Reviews | issue = 5 | pages = CD010312 | year = 2014 | pmid = 24833288 | doi = 10.1002/14651858.CD010312.pub2 | doi-access = free | pmc = 11055606 }} Currently, sulprostone along with SC-46275, MB-28767, ONO-AE-248 and other EP3 receptor agonists are in development as drugs for the possible treatment of stomach ulcers in humans.{{cite journal | vauthors = Markovič T, Jakopin Ž, Dolenc MS, Mlinarič-Raščan I | title = Structural features of subtype-selective EP receptor modulators | journal = Drug Discovery Today | volume = 22 | issue = 1 | pages = 57–71 | year = 2017 | pmid = 27506873 | doi = 10.1016/j.drudis.2016.08.003 | doi-access = free }}
References
{{Reflist|2}}
{{Eicosanoids}}
{{Oxytocics}}
{{Prostanoidergics}}