suproclone

{{Short description|Drug}}

{{Drugbox

| Verifiedfields = changed

| Watchedfields = changed

| verifiedrevid = 470475028

| IUPAC_name = [6-(7-chloro-1,8-naphthyridin-2-yl)-5-oxo-3,7-dihydro-2H-[1,4]dithiino[2,3-c]pyrrol-7-yl] 4-propanoylpiperazine-1-carboxylate

| image = Suproclone.svg

| width = 200

| tradename =

| pregnancy_AU =

| pregnancy_US =

| pregnancy_category =

| legal_AU =

| legal_CA =

| legal_UK =

| legal_US =

| legal_status =

| routes_of_administration =

| bioavailability =

| protein_bound =

| metabolism =

| elimination_half-life =

| excretion =

| CAS_number_Ref = {{cascite|correct|CAS}}

| CAS_number = 76535-71-2

| ATC_prefix = none

| ATC_suffix =

| PubChem = 53696

| DrugBank_Ref = {{drugbankcite|correct|drugbank}}

| DrugBank =

| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}

| ChemSpiderID = 48481

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = J4AM5D708G

| KEGG_Ref = {{keggcite|correct|kegg}}

| KEGG = D05975

| ChEMBL = 2105531

| C=22 | H=22 | Cl=1 | N=5 | O=4 | S=2

| smiles = O=C(N5CCN(C(=O)OC4C=1SCCSC=1C(=O)N4c2nc3nc(Cl)ccc3cc2)CC5)CC

| StdInChI_Ref = {{stdinchicite|correct|chemspider}}

| StdInChI = 1S/C22H22ClN5O4S2/c1-2-16(29)26-7-9-27(10-8-26)22(31)32-21-18-17(33-11-12-34-18)20(30)28(21)15-6-4-13-3-5-14(23)24-19(13)25-15/h3-6,21H,2,7-12H2,1H3

| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}

| StdInChIKey = IBAUKGNDWVSETP-UHFFFAOYSA-N

}}

Suproclone is a sedative and anxiolytic drug in the cyclopyrrolone family of drugs, developed by the French pharmaceutical company Rhône-Poulenc.{{cite web |author=Psychotropics.dk |title=suproclone |url=http://www.psychotropics.dk/moleculeView/default.aspx?ID=1532&Catalogtype=A&ChapterID=9&Thissortorder=1 |access-date=24 August 2009}} Other cyclopyrrolone drugs include zopiclone, pagoclone and suriclone.

Suproclone is very similar in structure to the related drug suriclone, but little information has been published about it specifically. However it can be expected that the mechanism of action by which suproclone produces its sedative and anxiolytic effects is by modulating benzodiazepine receptors (resulting in an increased response to endogenous GABA), in a similar manner to other drugs of this class.{{cite journal | vauthors = Gardner CR | title = Pharmacological profiles in vivo of benzodiazepine receptor ligands. | journal = Drug Development Research | date = 1988 | volume = 12 | issue = 1 | pages = 1–28 | doi = 10.1002/ddr.430120102 | s2cid = 85573551 }}{{cite book | vauthors = Doble A, Martin I, Nutt D | title = Calming the brain: benzodiazepines and related drugs from laboratory to clinic. | date = 23 October 2003 | publisher = Informa Healthcare | isbn = 1-84184-052-1 }}