talinolol
{{chembox
| Verifiedfields = changed
| Watchedfields = changed
| verifiedrevid = 444379759
| ImageFile=Talinolol.svg
| ImageSize = 300px
| ImageName = Chemical structure of talinolol
| IUPACName=(RS)-1-[4-[3-(tert-Butylamino)-2-hydroxypropoxy]phenyl]-3-cyclohexylurea
| OtherNames=
|Section1={{Chembox Identifiers
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = 3S82268BKG
| IUPHAR_ligand = 4664
| CASNo_Ref = {{cascite|correct|CAS}}
| CASNo=57460-41-0
| PubChem=68770
| ChEMBL_Ref = {{ebicite|changed|EBI}}
| ChEMBL = 152067
| SMILES=CC(C)(C)NCC(COC1=CC=C(C=C1)NC(=O)NC2CCCCC2)O
| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}}
| ChemSpiderID = 62014
| InChI = 1/C20H33N3O3/c1-20(2,3)21-13-17(24)14-26-18-11-9-16(10-12-18)23-19(25)22-15-7-5-4-6-8-15/h9-12,15,17,21,24H,4-8,13-14H2,1-3H3,(H2,22,23,25)
| InChIKey = MXFWWQICDIZSOA-UHFFFAOYAN
| StdInChI_Ref = {{stdinchicite|changed|chemspider}}
| StdInChI = 1S/C20H33N3O3/c1-20(2,3)21-13-17(24)14-26-18-11-9-16(10-12-18)23-19(25)22-15-7-5-4-6-8-15/h9-12,15,17,21,24H,4-8,13-14H2,1-3H3,(H2,22,23,25)
| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}}
| StdInChIKey = MXFWWQICDIZSOA-UHFFFAOYSA-N
}}
|Section2={{Chembox Properties
| C=20 | H=33 | N=3 | O=3
| Appearance=
| Density=
| MeltingPt=
| BoilingPt=
| Solubility=
}}
|Section6={{Chembox Pharmacology
| ATCCode_prefix = C07
| ATCCode_suffix = AB13
}}
|Section7={{Chembox Hazards
| MainHazards=
| FlashPt=
| AutoignitionPt =
}}
}}
Talinolol is a beta blocker.{{Cite journal
| last1 = Abmann | first1 = I.
| title = The actions of talinolol, a β1-selective beta blocker, in cardiac arrhythmia and acute myocardial infarction
| doi = 10.1185/03007999509110493
| journal = Current Medical Research and Opinion
| volume = 13
| issue = 6
| pages = 325–342
| year = 1995
| pmid = 8829891
| pmc =
}}
Stereochemistry
Talinolol contains a stereocenter and consists of two enantiomers. This is a racemate, i.e. a 1: 1 mixture of (R)- and the (S)-forms:F. v. Bruchhausen, G. Dannhardt, S. Ebel, A. W. Frahm, E. Hackenthal, U. Holzgrabe (Hrsg.): Hagers Handbuch der Pharmazeutischen Praxis: Band 9: Stoffe P-Z, Springer Verlag, Berlin, Aufl. 5, 2014, S. 767, {{ISBN|978-3-642-63389-8}}.
class="wikitable" style="text-align:center" |
class="hintergrundfarbe6"
! colspan="2"| Enantiomers of talinolol |
300 px (R)-talinolol CAS number: 71369-60-3 | 300 px |