tanespimycin

{{cs1 config|name-list-style=vanc|display-authors=6}}

{{chembox

| Verifiedfields = changed

| verifiedrevid = 477209222

| Name=Tanespimycin

| ImageFile = 17-N-Allylamino-17-demethoxygeldanamycin.svg

| ImageSize = 200px

| IUPACName = [(3S,5S,6R,7S,8E,10R,11S,12E,14E)-21-(allylamino)-6-hydroxy-5,11-dimethoxy-3,7,9,15-tetramethyl-16,20,22-trioxo-17-azabicyclo[16.3.1]docosa-8,12,14,18,21-pentaen-10-yl] carbamate

| OtherNames = 17-N-Allylamino-17-demethoxygeldanamycin
17-AAG

|Section1={{Chembox Identifiers

| IUPHAR_ligand = 7751

| InChI = 1/C31H43N3O8/c1-8-12-33-26-21-13-17(2)14-25(41-7)27(36)19(4)15-20(5)29(42-31(32)39)24(40-6)11-9-10-18(3)30(38)34-22(28(21)37)16-23(26)35/h8-11,15-17,19,24-25,27,29,33,36H,1,12-14H2,2-7H3,(H2,32,39)(H,34,38)/b11-9-,18-10+,20-15+/t17-,19+,24+,25+,27-,29+/m1/s1

| InChIKey = AYUNIORJHRXIBJ-TXHRRWQRBY

| SMILES1 = C[C@H]1C[C@@H]([C@@H]([C@H](/C=C(/[C@@H]([C@H](/C=C\C=C(\C(=O)NC2=CC(=O)C(=C(C1)C2=O)NCC=C)/C)OC)OC(=O)N)\C)C)O)OC

| StdInChI_Ref = {{stdinchicite|correct|chemspider}}

| StdInChI = 1S/C31H43N3O8/c1-8-12-33-26-21-13-17(2)14-25(41-7)27(36)19(4)15-20(5)29(42-31(32)39)24(40-6)11-9-10-18(3)30(38)34-22(28(21)37)16-23(26)35/h8-11,15-17,19,24-25,27,29,33,36H,1,12-14H2,2-7H3,(H2,32,39)(H,34,38)/b11-9-,18-10+,20-15+/t17-,19+,24+,25+,27-,29+/m1/s1

| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}

| StdInChIKey = AYUNIORJHRXIBJ-TXHRRWQRSA-N

| CASNo_Ref = {{cascite|changed|??}}

| CASNo = 75747-14-7

| PubChem = 6440175

| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}

| ChEMBL_Ref = {{ebicite|correct|EBI}}

| ChEMBL = 109480

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = 4GY0AVT3L4

| ChemSpiderID = 21106220

| SMILES = NC(=O)O[C@H]1C(/C)=C/[C@H](C)[C@@H](O)[C@@H](OC)C[C@H](C)C\C2=C(/NCC=C)C(=O)\C=C(\NC(=O)C(\C)=C\C=C/[C@@H]1OC)C2=O

}}

|Section2={{Chembox Properties

| C=31 | H=43 | N=3 | O=8

| Appearance =

| Density =

| MeltingPt =

| BoilingPt =

| Solubility =

}}

|Section7={{Chembox Hazards

| MainHazards =

| FlashPt =

| AutoignitionPt =

}}

}}

Tanespimycin (17-N-allylamino-17-demethoxygeldanamycin, 17-AAG) is a derivative of the antibiotic geldanamycin that is being studied in the treatment of cancer, specifically in younger patients with certain types of leukemia or solid tumors, especially kidney tumors.

It works by inhibiting Hsp90, which is expressed in those tumors.{{cite journal | vauthors = Dimopoulos MA, Mitsiades CS, Anderson KC, Richardson PG | title = Tanespimycin as antitumor therapy | journal = Clinical Lymphoma, Myeloma & Leukemia | volume = 11 | issue = 1 | pages = 17–22 | date = February 2011 | pmid = 21454186 | doi = 10.3816/CLML.2011.n.002 }}

It belongs to the family of drugs called antitumor antibiotics.

Clinical trials

Bristol-Myers Squibb conducted Phase 1{{ClinicalTrialsGov|NCT00093821|Phase 1 trial: 17-N-Allylamino-17-Demethoxygeldanamycin (17-AAG) in Treating Young Patients With Recurrent or Refractory Leukemia or Solid Tumors}}{{ClinicalTrialsGov|NCT00079404|Phase 1 trial: 17-N-Allylamino-17-Demethoxygeldanamycin in Treating Young Patients With Relapsed or Refractory Solid Tumors or Leukemia}} and Phase 2 clinical trials. However, in 2010 the company halted development of tanespimycin, during late-stage clinical trials as a potential treatment for multiple myeloma. While no definitive explanation was given, it has been suggested that Bristol-Myers Squibb halted development over concerns of the financial feasibility of tanespimycin development given the 2014 expiry of the patent on this compound, and the relative expense of manufacture.{{Cite web | url=http://www.myelomabeacon.com/news/2010/07/22/tanespimycin-development-halted/ | archive-url = https://web.archive.org/web/20101228122346/http://www.myelomabeacon.com/news/2010/07/22/tanespimycin-development-halted/ | archive-date = 28 December 2010 |title = Bristol-Myers Squibb Halts Development of Tanespimycin | date = 22 July 2010 | work = The Myeloma Beacon }}

References

{{Reflist}}