tebupirimfos
{{Chembox
| ImageFile =Tebupirimfos structure.svg
| ImageAlt =
| ImageName =
| PIN =O-(2-tert-Butylpyrimidin-5-yl) O-ethyl O-(propan-2-yl) phosphorothioate
| OtherNames =Tebupirimphos; Phostebupirim; MAT 7484; BAY-MAT 7484; HSDB 7136; Aztec
|Section1={{Chembox Identifiers
| 3DMet =
| Abbreviations =
| Beilstein =
| CASNo =96182-53-5
| CASNo_Ref = {{cascite|correct|CAS}}
| CASNoOther =
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = P036T39NSI
| ChEBI =
| ChemSpiderID =84419
| DrugBank =
| EC_number =
| EINECS =
| Gmelin =
| InChI =1S/C13H23N2O3PS/c1-7-16-19(20,17-10(2)3)18-11-8-14-12(15-9-11)13(4,5)6/h8-10H,7H2,1-6H3
| KEGG =
| MeSHName =
| PubChem =93516
| RTECS =
| SMILES = S=P(OC(C)C)(OCC)OC1=CN=C(C(C)(C)C)N=C1
| UNNumber =UN2810
}}
|Section2={{Chembox Properties
| AtmosphericOHRateConstant =
| Appearance =Amber to brown liquid{{PubChem|93516}}
| BoilingPtC = 135
| BoilingPt_notes =1.5 mmHg{{cite web | url=http://chemservice.com/media/product/msds/N-13503.pdf | title=MSDS via Chem Service Inc. | access-date=January 12, 2013}}
| Density =1.146 g/cm3
| C=13 | H=23 | N=2 | O=3 | P=1 | S=1
| HenryConstant =
| LogP =
| MeltingPt =
| MeltingPt_notes =
| pKa =
| pKb =
| Solubility =
| SolubleOther =
| Solvent =
| VaporPressure =}}
|Section3={{Chembox Structure
| Coordination =
| CrystalStruct =
| MolShape = }}
|Section4={{Chembox Thermochemistry
| DeltaHc =
| DeltaHf =
| Entropy =
| HeatCapacity = }}
|Section5={{Chembox Pharmacology
| AdminRoutes =
| Bioavail =
| Excretion =
| HalfLife =
| Metabolism =
| Legal_status =
| Legal_US =
| Legal_UK =
| Legal_AU =
| Legal_CA =
| Pregnancy_category =
| Pregnancy_AU =
| Pregnancy_US =
| ProteinBound = }}
|Section6={{Chembox Explosive
| DetonationV =
| FrictionSens =
| REFactor =
| ShockSens = }}
|Section7={{Chembox Hazards
| AutoignitionPtC =
| ExploLimits =
| ExternalSDS =
| FlashPtC = 93
| LD50 =
| MainHazards =
| NFPA-H =4
| NFPA-F =1
| NFPA-R =1
| NFPA-S =
| PEL =
| HPhrases =
| PPhrases =
| GHS_ref =
}}
|Section8={{Chembox Related
| OtherFunction_label = insecticide
| OtherAnions =
| OtherCations =
| OtherCompounds =
| OtherFunction = }}
}}
Tebupirimfos, also known as phostebupirim, is an organothiophosphate insecticide. It is used on corn crops, including popcorn.{{cite web | url=https://docs.google.com/viewer?a=v&q=cache:puia407qlioJ:www.epa.gov/oppsrrd1/REDs/phostebupirim_red.pdf+&hl=en&gl=us&pid=bl&srcid=ADGEESj-u2ZgQsK_2vyU3_-28uX1YQrZexyt_rxU4oPEVXO_MdGYJ3SbFzBcJp4QdFQyKmfmLB8_Zg_YYiD0Z_4U-d0zcPfdj-HYzh9aUxSL9hIG04cLHw6BuNuokWRqDiEYF39zLMmR&sig=AHIEtbQDI3J32jleRE7XMM6Q_yGwoIR7_w | title=US Environmental Protection Agency Office of Pesticide Programs Reregistration Eligibility Decision for Phostebupirim | publisher=United States EPA | date=July 31, 2006 | access-date=January 11, 2013 | author=Edwards, Debra}}{{cite web | url=https://docs.google.com/viewer?a=v&q=cache:svSYlXz01EcJ:www.epa.gov/oppsrrd1/REDs/factsheets/phostredfact.pdf+&hl=en&gl=us&pid=bl&srcid=ADGEESiqTUipefcty0lTEmJaREehETIAfQw_iAmVrGQ_9GNof8tj4quJ29uVAoKvyqdrfau3mrK7IYV9eDPm4oZf9b8oR2Z_-tvBA1y64386fryJ9Gf7LCwvJNDdE41iVnt5cFmn99Wy&sig=AHIEtbSpEAYRqKJw0aux3RunUVf47u5jxA | title=US EPA Phostebupirim Facts | publisher=United States EPA | date=September 2000 | access-date=January 11, 2013}}
References
{{reflist}}
Additional resources
- {{cite book | url = https://books.google.com/books?id=fjaephJRpeYC&q=Phostebupirim&pg=PA23 | title = Report on FQPA tolerance reassessment progress and interim risk management decision : phostebupirim | author = United States, Environmental Protection Agency | publisher = DIANE Publishing | isbn = 1428902163}}
{{Insecticides}}
{{Acetylcholine metabolism and transport modulators}}
Category:Acetylcholinesterase inhibitors
Category:Organothiophosphate esters