tectorigenin

{{chembox

| Verifiedfields = changed

| Watchedfields = changed

| verifiedrevid = 401016232

| Name = Tectorigenin

| ImageFile = Tectorigenin.svg

| ImageSize = 220px

| ImageFile1 = Tectorigenin-3D-balls.png

| ImageSize1 = 220

| ImageAlt1 = Tectorigenin molecule

| IUPACName = 4′,5,7-Trihydroxy-6-methoxyisoflavone

| SystematicName = 5,7-Dihydroxy-3-(4-hydroxyphenyl)-6-methoxy-4H-1-benzopyran-4-one

| OtherNames = Tectorigenine

|Section1={{Chembox Identifiers

| CASNo_Ref = {{cascite|correct|CAS}}

| CASNo = 548-77-6

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = 855130H9CO

| PubChem = 5281811

| Beilstein =

| ChEMBL_Ref = {{ebicite|changed|EBI}}

| ChEMBL = 242740

| SMILES = COC1=C(C=C2C(=C1O)C(=O)C(=CO2)C3=CC=C(C=C3)O)O

| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}}

| ChemSpiderID = 4445122

| InChI = 1/C16H12O6/c1-21-16-11(18)6-12-13(15(16)20)14(19)10(7-22-12)8-2-4-9(17)5-3-8/h2-7,17-18,20H,1H3

| InChIKey = OBBCRPUNCUPUOS-UHFFFAOYAZ

| StdInChI_Ref = {{stdinchicite|changed|chemspider}}

| StdInChI = 1S/C16H12O6/c1-21-16-11(18)6-12-13(15(16)20)14(19)10(7-22-12)8-2-4-9(17)5-3-8/h2-7,17-18,20H,1H3

| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}}

| StdInChIKey = OBBCRPUNCUPUOS-UHFFFAOYSA-N

| RTECS =

| MeSHName =

| ChEBI_Ref = {{ebicite|changed|EBI}}

| ChEBI = 9429

| KEGG_Ref = {{keggcite|changed|kegg}}

| KEGG = C10534

}}

|Section2={{Chembox Properties

| C = 16 | H = 12 | O = 6

| Appearance =

| Density =

| MeltingPt =

| BoilingPt =

| Solubility = }}

|Section3={{Chembox Hazards

| MainHazards =

| FlashPt =

| AutoignitionPt = }}

}}

Tectorigenin is an O-methylated isoflavone, a type of flavonoid. It ha been isolated from leopard lily (Belamcanda chinensis),{{cite journal | doi = 10.1093/carcin/bgi092 | title = Tectorigenin and other phytochemicals extracted from leopard lily Belamcanda chinensis affect new and established targets for therapies in prostate cancer | date = 2005 | last1 = Thelen | first1 = Paul | last2 = Scharf | first2 = Jens-Gerd | last3 = Burfeind | first3 = Peter | last4 = Hemmerlein | first4 = Bernhard | last5 = Wuttke | first5 = Wolfgang | last6 = Spengler | first6 = Barbara | last7 = Christoffel | first7 = Volker | last8 = Ringert | first8 = Rolf-Hermann | last9 = Seidlová-Wuttke | first9 = Dana | journal = Carcinogenesis | volume = 26 | issue = 8 | pages = 1360–1367 | pmid = 15845653 | doi-access = free }} Algerian iris (Iris unguicularis){{cite journal | doi = 10.3987/COM-10-S(E)6 | title = New and Known Constituents from Iris unguicularis and Their Antioxidant Activity | date = 2010 | last1 = Atta-Ur-Rahman | last2 = Hareem | first2 = Sumaira | last3 = Iqbal Choudhary | first3 = M. | last4 = Sener | first4 = Bilge | last5 = Abbaskhan | first5 = Ahmed | last6 = Siddiqui | first6 = Hina | last7 = Anjum | first7 = Shazia | last8 = Orhan | first8 = Ilkay | last9 = Gurbuz | first9 = Ilhan | last10 = Ayanoglu | first10 = Filiz | journal = Heterocycles | volume = 82 | page = 813 | doi-access = free }} and East Asian arrowroot (Pueraria thunbergiana).{{cite journal | doi = 10.1248/bpb.24.1117 | title = Tectorigenin, an Isoflavone of Pueraria thunbergiana BENTH., Induces Differentiation and Apoptosis in Human Promyelocytic Leukemia HL-60 Cells | date = 2001 | last1 = Lee | first1 = Kyung-Tae | last2 = Sohn | first2 = Il-Cheol | last3 = Kim | first3 = Young-Kwan | last4 = Choi | first4 = Jung-Hye | last5 = Choi | first5 = Jong-Won | last6 = Park | first6 = Hee-Juhn | last7 = Itoh | first7 = Yoshie | last8 = Miyamoto | first8 = Ken-Ichi | journal = Biological and Pharmaceutical Bulletin | volume = 24 | issue = 10 | pages = 1117–1121 | pmid = 11642314 | doi-access = free }}