telapristone

{{Short description|Chemical compound}}

{{Drugbox

| verifiedrevid = 443493485

| IUPAC_name = [(8S,11R,13S,14S,17R)-11-[4-(Dimethylamino)phenyl]-17-(2-methoxyacetyl)-13-methyl-3-oxo-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-17-yl] acetate

| image = Telapristone.svg

| width = 250px

| tradename =

| pregnancy_AU =

| pregnancy_US =

| pregnancy_category =

| legal_AU =

| legal_CA =

| legal_UK =

| legal_US =

| legal_status = Investigational

| routes_of_administration =

| class = Selective progesterone receptor modulator

| bioavailability =

| protein_bound =

| metabolism =

| elimination_half-life =

| excretion =

| CAS_number = 198414-31-2

| ATC_prefix =

| ATC_suffix =

| ATC_supplemental =

| PubChem = 9806190

| PubChemSubstance = 347910049

| DrugBank_Ref = {{drugbankcite|correct|drugbank}}

| DrugBank = DB05253

| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}

| ChemSpiderID = 7981950

| ChEMBL = 2105694

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = 1K9EYK92PQ

| synonyms = CDB-4124; Proellex; Progenta; 17β-(Acetyloxy)-11β-[4-(dimethylamino)phenyl]-17α-(2-methoxyacetyl)estra-4,9-dien-3-one

| C=31 | H=39 | N=1 | O=5

| SMILES = O=C5\C=C3/C(=C2/[C@@H](c1ccc(N(C)C)cc1)C[C@@]4([C@@](OC(=O)C)(C(=O)COC)CC[C@H]4[C@@H]2CC3)C)CC5

| StdInChI_Ref = {{stdinchicite|correct|chemspider}}

| StdInChI = 1S/C31H39NO5/c1-19(33)37-31(28(35)18-36-5)15-14-27-25-12-8-21-16-23(34)11-13-24(21)29(25)26(17-30(27,31)2)20-6-9-22(10-7-20)32(3)4/h6-7,9-10,16,25-27H,8,11-15,17-18H2,1-5H3/t25-,26+,27-,30-,31-/m0/s1

| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}

| StdInChIKey = JVBGZFRPTRKSBB-MJBQOYBXSA-N

}}

Telapristone ({{abbrlink|INN|International Nonproprietary Name}}), as telapristone acetate (proposed brand names Proellex, Progenta; former code name CDB-4124), is a synthetic, steroidal selective progesterone receptor modulator (SPRM) related to mifepristone which is under development by Repros Therapeutics for the treatment of breast cancer, endometriosis, and uterine fibroids.{{cite web | url=http://adisinsight.springer.com/drugs/800014404 | title=Telapristone - Repros Therapeutics - AdisInsight }}{{cite journal | vauthors = Attardi BJ, Burgenson J, Hild SA, Reel JR | title = In vitro antiprogestational/antiglucocorticoid activity and progestin and glucocorticoid receptor binding of the putative metabolites and synthetic derivatives of CDB-2914, CDB-4124, and mifepristone | journal = J. Steroid Biochem. Mol. Biol. | volume = 88 | issue = 3 | pages = 277–88 | year = 2004 | pmid = 15120421 | doi = 10.1016/j.jsbmb.2003.12.004 | s2cid = 23958876 }} It was originally developed by the National Institutes of Health (NIH), and, as of 2017, is in phase II clinical trials for the aforementioned indications. In addition to its activity as an SPRM, the drug also has some antiglucocorticoid activity.{{cite journal | vauthors = Whitaker LH, Williams AR, Critchley HO | title = Selective progesterone receptor modulators | journal = Curr. Opin. Obstet. Gynecol. | volume = 26 | issue = 4 | pages = 237–42 | year = 2014 | pmid = 24950125 | doi = 10.1097/GCO.0000000000000082 | s2cid = 37474964 }}