teprenone

{{Short description|Chemical compound}}

{{Drugbox

| Watchedfields = changed

| verifiedrevid = 443578315

| image = Teprenone.svg

| width = 280

| tradename = Selbex

| Drugs.com = {{drugs.com|international|teprenone}}

| pregnancy_AU =

| pregnancy_category =

| routes_of_administration =

| ATC_prefix = A02

| ATC_suffix = BX15

| ATC_supplemental = {{ATCvet|A02|BX15}}

| legal_AU =

| legal_AU_comment =

| legal_BR =

| legal_BR_comment =

| legal_CA =

| legal_CA_comment =

| legal_DE =

| legal_DE_comment =

| legal_NZ =

| legal_NZ_comment =

| legal_UK =

| legal_UK_comment =

| legal_US =

| legal_US_comment =

| legal_EU =

| legal_EU_comment =

| legal_UN =

| legal_UN_comment =

| legal_status = Rx-only

| bioavailability =

| protein_bound =

| metabolism =

| elimination_half-life =

| excretion =

| CAS_number = 6809-52-5

| PubChem = 5282199

| DrugBank_Ref = {{drugbankcite|correct|drugbank}}

| DrugBank = DB15955

| ChemSpiderID = 29787024

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = S8S8451A4O

| KEGG_Ref = {{keggcite|correct|kegg}}

| KEGG = D01827

| ChEBI = 31649

| ChEMBL = 79686

| IUPAC_name = (5E,9E,13E)-6,10,14,18-tetramethylnonadeca-5,9,13,17-tetraen-2-one

| C=23 | H=38 | O=1

| SMILES = CC(C)=CCC\C(C)=C\CC\C(C)=C\CC\C(C)=C\CCC(C)=O

| StdInChI = 1S/C23H38O/c1-19(2)11-7-12-20(3)13-8-14-21(4)15-9-16-22(5)17-10-18-23(6)24/h11,13,15,17H,7-10,12,14,16,18H2,1-6H3/b20-13+,21-15+,22-17+

| StdInChIKey = HUCXKZBETONXFO-NJFMWZAGSA-N

}}

Teprenone (or geranylgeranylacetone), sold under the brand name Selbex,{{cite journal | vauthors = Liu X, Jia B, Lin S | title = [Teprenone in the treatment of chronic superficial gastritis, a multicentre study] | language = Chinese | journal = Zhonghua Nei Ke Za Zhi | volume = 35 | issue = 1 | pages = 12–4 | date = January 1996 | pmid = 9275638 | doi = | url = | issn = }} is a medication used for the treatment of gastric ulcers.{{cite journal |vauthors=Kitahata H, Nozaki J, Kawahito S, Tomino T, Oshita S |title=Low-dose sevoflurane inhalation enhances late cardioprotection from the anti-ulcer drug geranylgeranylacetone |journal=Anesth. Analg. |volume=107 |issue=3 |pages=755–61 |date=September 2008 |pmid=18713879 |doi=10.1213/ane.0b013e31817f0e61 |s2cid=19387865 |doi-access=free }}