testosterone acetate

{{Short description|Chemical compound}}

{{Drugbox

| Verifiedfields =

| Watchedfields =

| verifiedrevid =

| IUPAC_name = [(8R,9S,10R,13S,14S,17S)-10,13-dimethyl-3-oxo-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-17-yl] acetate

| image = Testosterone acetate.svg

| width = 250px

| image2 = Testosterone acetate molecule ball.png

| width2 = 250px

| tradename = Aceto-Sterandryl, Aceto-Testoviron, Amolisin, Androtest A, Deposteron, Farmatest, Perandrone A

| pregnancy_AU =

| pregnancy_US =

| pregnancy_category =

| legal_AU =

| legal_CA =

| legal_UK =

| legal_US =

| legal_status =

| routes_of_administration = Intramuscular injection

| bioavailability =

| protein_bound =

| metabolism =

| elimination_half-life =

| excretion =

| CAS_number_Ref =

| CAS_number = 1045-69-8

| CAS_supplemental =

| ATC_prefix =

| ATC_suffix =

| PubChem = 92145

| DrugBank_Ref =

| DrugBank =

| ChemSpiderID_Ref =

| ChemSpiderID = 83191

| UNII = 5652105Y6S

| ChEBI = 16524

| ChEMBL = 488762

| KEGG = C03027

| synonyms = Testosterone ethanoate; Testosterone 17β-acetate; Androst-4-en-17β-ol-3-one 17β-acetate

| C=21 | H=30 | O=3

| SMILES = CC(=O)O[C@H]1CC[C@@H]2[C@@]1(CC[C@H]3[C@H]2CCC4=CC(=O)CC[C@]34C)C

| StdInChI_Ref =

| StdInChI = 1S/C21H30O3/c1-13(22)24-19-7-6-17-16-5-4-14-12-15(23)8-10-20(14,2)18(16)9-11-21(17,19)3/h12,16-19H,4-11H2,1-3H3/t16-,17-,18-,19-,20-,21-/m0/s1

| StdInChIKey_Ref =

| StdInChIKey = DJPZSBANTAQNFN-PXQJOHHUSA-N

}}

Testosterone acetate (brand names Aceto-Sterandryl, Aceto-Testoviron, Amolisin, Androtest A, Deposteron, Farmatest, Perandrone A), or testosterone ethanoate, also known as androst-4-en-17β-ol-3-one 17β-acetate, is an androgen and anabolic steroid and a testosterone ester.{{cite book | vauthors = Elks J |title=The Dictionary of Drugs: Chemical Data: Chemical Data, Structures and Bibliographies|url=https://books.google.com/books?id=0vXTBwAAQBAJ&pg=PA641|date=14 November 2014|publisher=Springer|isbn=978-1-4757-2085-3|pages=641–642}}{{cite book|title=Index Nominum 2000: International Drug Directory|url=https://books.google.com/books?id=5GpcTQD_L2oC&pg=PA976|date=January 2000|publisher=Taylor & Francis|isbn=978-3-88763-075-1}}{{cite book | vauthors = Morton IK, Hall JM |title=Concise Dictionary of Pharmacological Agents: Properties and Synonyms|url=https://books.google.com/books?id=tsjrCAAAQBAJ&pg=PA270|date=6 December 2012|publisher=Springer Science & Business Media|isbn=978-94-011-4439-1}} The drug was first described in 1936 and was one of the first androgen esters and esters of testosterone to be synthesized.{{cite journal | vauthors = Miescher K, Wettstein A, Tschopp E | title = The activation of the male sex hormones. II | journal = The Biochemical Journal | volume = 30 | issue = 11 | pages = 1977–1990 | date = November 1936 | pmid = 16746250 | pmc = 1263292 | doi = 10.1042/bj0301977 }}{{cite journal| vauthors = Parkes AS |title=Increasing the Effectiveness of Testosterone|journal=The Lancet|volume=228|issue=5899|year=1936|pages=674–676|issn=0140-6736|doi=10.1016/S0140-6736(00)80929-0}}