testosterone phosphate

{{Short description|Chemical compound}}

{{Drugbox

| Verifiedfields =

| Watchedfields =

| verifiedrevid =

| IUPAC_name = [(8R,9S,10R,13S,14S,17S)-10,13-dimethyl-3-oxo-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-17-yl] dihydrogen phosphate

| image = Testosterone phosphate.svg

| width = 225px

| tradename = Telipex Aquosum

| pregnancy_AU =

| pregnancy_US =

| pregnancy_category =

| legal_AU =

| legal_CA =

| legal_UK =

| legal_US =

| legal_status =

| routes_of_administration = Intramuscular injection

| bioavailability =

| protein_bound =

| metabolism =

| elimination_half-life =

| excretion =

| CAS_number_Ref =

| CAS_number = 1242-14-4

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = HNC82VV8K8

| CAS_supplemental =

| ATC_prefix =

| ATC_suffix =

| PubChem = 9929198

| DrugBank_Ref =

| DrugBank =

| ChemSpiderID_Ref =

| ChemSpiderID = 8104829

| synonyms = Testosterone 17β-phosphate; Testosterone 17β-(dihydrogen phosphate)

| C=19 | H=29 | O=5 | P=1

| SMILES = C[C@]12CC[C@H]3[C@H]([C@@H]1CC[C@@H]2OP(=O)(O)O)CCC4=CC(=O)CC[C@]34C

| StdInChI_Ref =

| StdInChI = 1S/C19H29O5P/c1-18-9-7-13(20)11-12(18)3-4-14-15-5-6-17(24-25(21,22)23)19(15,2)10-8-16(14)18/h11,14-17H,3-10H2,1-2H3,(H2,21,22,23)/t14-,15-,16-,17-,18-,19-/m0/s1

| StdInChIKey_Ref =

| StdInChIKey = NWJXKHVJFGAOMY-DYKIIFRCSA-N

}}

Testosterone phosphate (brand name Telipex Aquosum) is an androgen and anabolic steroid and a testosterone ester.{{cite book| vauthors = Elks J |title=The Dictionary of Drugs: Chemical Data: Chemical Data, Structures and Bibliographies|url=https://books.google.com/books?id=0vXTBwAAQBAJ&pg=PA641|date=14 November 2014|publisher=Springer|isbn=978-1-4757-2085-3|pages=641–642}}{{cite book|title=Index Nominum 2000: International Drug Directory|url=https://books.google.com/books?id=5GpcTQD_L2oC&pg=PA976|date=January 2000|publisher=Taylor & Francis|isbn=978-3-88763-075-1}}{{cite book| vauthors = Morton IK, Hall JM |title=Concise Dictionary of Pharmacological Agents: Properties and Synonyms|url=https://books.google.com/books?id=tsjrCAAAQBAJ&pg=PA270|date=6 December 2012|publisher=Springer Science & Business Media|isbn=978-94-011-4439-1}} Its structure is contained within polytestosterone phloretin phosphate.{{cite patent |country = US | number = 2928849 | status = patent | title = High-molecular weight derivatives of steroids containing hydroxyl groups and method of producing the same | pubdate = 15 March 1960 | fdate = 8 November 1954 | pridate = 20 November 1953 | inventor = Bertil HK, Birger, Enok LT, Jakob FH, Rihardt DE | assign1 = Leo AB | url = https://www.google.com/patents/US2928849}}