thromboxane B2

{{chembox

| Verifiedfields = changed

| Watchedfields = changed

| verifiedrevid = 428769862

| ImageFile=Thromboxane B2.svg

| ImageSize=250px

| ImageFileL2=ThromboxaneB2 spacefill.png

| ImageFileR2=ThromboxaneB2.png

| PIN=(5Z)-7-{(2R,3S,4S,6Ξ)-4,6-Dihydroxy-2-[(1E,3S)-3-hydroxyoct-1-en-1-yl]oxan-2-yl}hept-5-enoic acid

| OtherNames=

|Section1={{Chembox Identifiers

| CASNo_Ref = {{cascite|correct|??}}

| CASNo=54397-85-2

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = V94M3R26ZV

| PubChem=5283137

| ChEBI_Ref = {{ebicite|changed|EBI}}

| ChEBI = 28728

| SMILES= CCCCC[C@H](O)\C=C\[C@H]1OC(O)C[C@H](O)[C@@H]1C\C=C/CCCC(O)=O

| MeSHName=Thromboxane+B2

}}

|Section2={{Chembox Properties

| Formula=C20H34O6

| MolarMass=370.48 g/mol

| Appearance=

| Density=

| MeltingPt=

| BoilingPt=

| Solubility=

}}

|Section3={{Chembox Hazards

| MainHazards=

| FlashPt=

| AutoignitionPt =

}}

}}

Thromboxane B2 (TXB2) is an inactive metabolite/product of thromboxane A2. It is almost completely cleared in the urine.

It itself is not involved in platelet activation and aggregation in case of a wound, but its precursor, thromboxane A2, is. Thromboxane A2 synthesis is the target of the drug aspirin, which inhibits the COX-1 enzyme (the source of thromboxane A2 in platelets). {{cite web |url=http://cancerweb.ncl.ac.uk/cgi-bin/omd?thromboxane+b2 |title=Definition: thromboxane b2 from Online Medical Dictionary |format= |accessdate=2008-11-02}}

2-(3,4-Di-hydroxyphenyl)-ethanol (DHPE) is a phenolic component of extra-virgin olive oil. An olive oil fraction containing DHPE can inhibit platelet aggregation and thromboxane B2 formation in vitro.Inhibition of platelet aggregation and eicosanoid production by phenolic components of olive oil. Anna Petroni, Milena Blasevich, Marco Salami, Nadia Papini, Gian F. Montedoro and Claudio Gallia, Thrombosis Research, 15 April 1995, Volume 78, Issue 2, Pages 151–160, {{doi|10.1016/0049-3848(95)00043-7}}

References

{{reflist}}

{{Eicosanoids}}

Category:Eicosanoids