thyronamine
{{Chembox
| Verifiedfields = changed
| Watchedfields = changed
| verifiedrevid = 470609845
| ImageFile = Thyronamine.svg
| ImageSize = 200px
| ImageFile2 = Thyronamine3d.png
| ImageSize2 = 200px
| PIN = 4-[4-(2-Aminoethyl)phenoxy]phenol
| OtherNames =
|Section1={{Chembox Identifiers
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| ChemSpiderID = 2340781
| InChI = 1/C14H15NO2/c15-10-9-11-1-5-13(6-2-11)17-14-7-3-12(16)4-8-14/h1-8,16H,9-10,15H2
| InChIKey = OVUVNKDANCKDCK-UHFFFAOYAP
| ChEMBL_Ref = {{ebicite|correct|EBI}}
| ChEMBL = 201896
| StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| StdInChI = 1S/C14H15NO2/c15-10-9-11-1-5-13(6-2-11)17-14-7-3-12(16)4-8-14/h1-8,16H,9-10,15H2
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
| StdInChIKey = OVUVNKDANCKDCK-UHFFFAOYSA-N
| CASNo_Ref = {{cascite|changed|??}}
| CASNo = 500-78-7
| PubChem = 3083601
| SMILES = O(c1ccc(cc1)CCN)c2ccc(O)cc2
| MeSHName = thyronamine
}}
|Section2={{Chembox Properties
| C=14 | H=15 | N=1 | O=2
| Appearance =
| Density =
| MeltingPt =
| BoilingPt =
}}
|Section3={{Chembox Hazards
| MainHazards =
| FlashPt =
| AutoignitionPt =
}}
}}
Thyronamine refers both to a molecule, and to derivatives of that molecule: a family of decarboxylated and deiodinated metabolites of the thyroid hormones thyroxine (T4) and 3,5,3'-triiodothyronine (T3).
Types
The group includes:
- Thyronamine (T0AM)
- 3-Iodothyronamine (T1AM), which is the most notable one as it is a trace amine found in the nervous system. It is a possible candidate for the natural ligand of the trace amine-associated receptor TAAR1 (TAR1), an intracellular G protein-coupled receptor{{cite journal | vauthors = Piehl S, Hoefig CS, Scanlan TS, Köhrle J | year = 2011 | title = Thyronamines - Past, Present, and Future | journal = Endocrine Reviews | volume = 32 | pages = 64–80 | doi = 10.1210/er.2009-0040 | pmid = 20880963 | issue = 1| doi-access = free }}
- 3,5-Diiodothyronamine (T2AM)
- 3,5,3'-Triiodothyronamine (T3AM)
See also
References
{{Reflist}}
{{Thyroid hormone intermediates}}
{{TAAR ligands}}
{{Phenethylamines}}
Category:Methoxyphenethylamines