tiamulin
{{Short description|Chemical compound}}
{{Drugbox
| Verifiedfields = changed
| Watchedfields = changed
| verifiedrevid = 376122925
| IUPAC_name = [(1S,2R,3S,4S,6R,7R,8R,14R)-4-ethenyl-3-hydroxy-2,4,7,14-tetramethyl-9-oxo-6-tricyclo[5.4.3.01,8]tetradecanyl] 2-[2-(diethylamino)ethylsulfanyl]acetate
| image = Tiamulin skeletal.svg
| width =
| tradename = Dynamutilin, others
| pregnancy_AU =
| pregnancy_US =
| pregnancy_category =
| legal_AU =
| legal_CA =
| legal_UK =
| legal_US =
| legal_status = Veterinary use only
| routes_of_administration = Oral
| bioavailability =
| protein_bound =
| metabolism =
| elimination_half-life =
| excretion =
| CAS_number_Ref = {{cascite|correct|??}}
| CAS_number = 55297-95-5
| ATCvet = yes
| ATC_prefix = J01
| ATC_suffix = XQ01
| ATC_supplemental =
| PubChem = 656958
| DrugBank_Ref = {{drugbankcite|correct|drugbank}}
| DrugBank =
| UNII_Ref = {{fdacite|changed|FDA}}
| UNII = E38WZ4U54R
| ChEMBL_Ref = {{ebicite|changed|EBI}}
| ChEMBL = 498466
| ChEBI_Ref = {{ebicite|changed|EBI}}
| ChEBI = 44137
| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}}
| ChemSpiderID = 571196
| chemical_formula =
| C=28 | H=47 | N=1 | O=4 | S=1
| smiles = CCN(CC)CCSCC(=O)O[C@@H]1C[C@@]([C@H]([C@@H]([C@@]23CC[C@H]([C@@]1([C@@H]2C(=O)CC3)C)C)C)O)(C)C=C
| StdInChI_Ref = {{stdinchicite|changed|chemspider}}
| StdInChI = 1S/C28H47NO4S/c1-8-26(6)17-22(33-23(31)18-34-16-15-29(9-2)10-3)27(7)19(4)11-13-28(20(5)25(26)32)14-12-21(30)24(27)28/h8,19-20,22,24-25,32H,1,9-18H2,2-7H3/t19-,20+,22-,24+,25+,26-,27+,28+/m1/s1
| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}}
| StdInChIKey = UURAUHCOJAIIRQ-QGLSALSOSA-N
}}
Tiamulin (previously thiamutilin) is a pleuromutilin antibiotic drug that is used in veterinary medicine particularly for pigs and poultry.{{cite web | url = http://www.bioagrimix.com/haccp/html/tiamulin.htm | work = HACCP | title = Tiamulin in Veterinary Medicine | archive-url = https://web.archive.org/web/20090610080725/http://www.bioagrimix.com/haccp/html/tiamulin.htm | archive-date=2009-06-10 }}{{cite journal | vauthors = Long KS, Hansen LH, Jakobsen L, Vester B | title = Interaction of pleuromutilin derivatives with the ribosomal peptidyl transferase center | journal = Antimicrobial Agents and Chemotherapy | volume = 50 | issue = 4 | pages = 1458–62 | date = April 2006 | pmid = 16569865 | pmc = 1426994 | doi = 10.1128/AAC.50.4.1458-1462.2006 | url = }}
Tiamulin is a diterpene antimicrobial with a pleuromutilin chemical structure similar to that of valnemulin.{{cite web | url = http://www.emea.europa.eu/pdfs/vet/mrls/074700en.pdf | work = EMEA | title = Tiamulin Summary Report }}
References
{{reflist}}
{{Other antibacterials}}
Category:Pleuromutilin antibiotics
Category:Diethylamino compounds
{{antibiotic-stub}}