tiapamil
{{short description|Chemical compound}}
{{Infobox drug
| drug_name =
| INN =
| type =
| image = Dimeditiapramine.svg
| image2 = Dimeditiapramine 3D spacefill.png
| alt =
| caption =
| pronounce =
| tradename =
| Drugs.com =
| MedlinePlus =
| pregnancy_AU =
| pregnancy_AU_comment =
| pregnancy_category=
| routes_of_administration =
| ATCvet =
| ATC_prefix =
| ATC_suffix =
| legal_AU =
| legal_AU_comment =
| legal_BR =
| legal_BR_comment =
| legal_CA =
| legal_CA_comment =
| legal_DE =
| legal_DE_comment =
| legal_NZ =
| legal_NZ_comment =
| legal_UK =
| legal_UK_comment =
| legal_US =
| legal_US_comment =
| legal_EU =
| legal_EU_comment =
| legal_UN =
| legal_UN_comment =
| legal_status =
| bioavailability =
| protein_bound =
| metabolism =
| metabolites =
| onset =
| elimination_half-life =
| duration_of_action=
| excretion =
| CAS_number_Ref = {{cascite|correct|??}}
| CAS_number = 57010-31-8
| PubChem= 42107
| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}}
| ChemSpiderID = 38399
| UNII_Ref = {{fdacite|changed|FDA}}
| UNII = 0ONY823T4J
| smiles=CN(CCCC1(S(=O)(=O)CCCS1(=O)=O)C2=CC(=C(C=C2)OC)OC)CCC3=CC(=C(C=C3)OC)OC
| DrugBank =
| synonyms = Dimeditiapramine; Ro 11-1781
| IUPAC_name = 2-(3,4-Dimethoxyphenyl)-2-(3-
| C=26 | H=37 | N=1 | O=8 | S=2
}}
Tiapamil (INN; also known as dimeditiapramine) is a calcium antagonist or calcium channel blocker.{{cite journal | vauthors = Cocco G, Strozzi C, Chu D | title = Human electropharmacology of the calcium antagonist dimeditiapramine (Ro 11-1781) in coronary patients | journal = Clinical Cardiology | volume = 2 | issue = 3 | pages = 212–216 | date = June 1979 | pmid = 509799 | doi = 10.1002/clc.4960020307 | s2cid = 24609271 | doi-access = }}{{cite journal | vauthors = Nowak FG, Cocco G, Chu D, Gasser DF | title = Antiarrhythmic effect of the calcium antagonist tiapamil (Ro 11-1781) by intravenous administration in patients with coronary heart disease | journal = Clinical Cardiology | volume = 3 | issue = 6 | pages = 371–376 | date = December 1980 | pmid = 6161729 | doi = 10.1002/clc.4960030603 | s2cid = 196402596 | doi-access = free }} It is an experimental drug that has never been marketed.{{cite web | url = https://adisinsight.springer.com/drugs/800028673 | title = Tiapamil | work = AdisInsight | publisher = Springer Nature Switzerland AG }}
Tiapamil has been described as an antianginal agent. It exhibits properties of anti-arrhythmic medications. These are medications that are used to treat unusually fast or irregular heartbeats. Examples of arrhytmthic conditions include atrial fibrillation, atrial flutter, and super-ventricular tachycardia.{{cite journal | vauthors = Cocco G, Chu D, Strozzi C | title = Dimeditiapramine (Ro 11-1781), a new calcium antagonist, in the management of supraventricular tachyarrhythmias in patients with acute myocardial infarction | journal = Clinical Cardiology | volume = 2 | issue = 2 | pages = 131–134 | date = April 1979 | pmid = 262567 | doi = 10.1002/clc.4960020208 | s2cid = 38589956 }} Upon research, the drug shows promising effects on treatment of these condition. Research seeks to create a treatment with tiapamil in order to mitigate the side effects of the more commonly prescribed calcium antagonist and anti-hypertensive verapamil. The two drugs have similar properties; however, tiapamil appears to treat arrhythmic conditions without many of the hypotensive, negative inotropic, and negative chronotropic side effects. Tiapamil is a calcium channel blocker that acts on the slow calcium channels. It can treat ventricular arrhythmias to a higher degree than traditional calcium antagonists.{{medcn|date=December 2022}}