tildipirosin

{{Short description|Medication}}

{{Use American English|date=August 2023}}

{{Use dmy dates|date=August 2023}}

{{cs1 config |name-list-style=vanc |display-authors=6}}

{{Infobox drug

| drug_name =

| INN =

| type =

| image = Tildipirosin.png

| width =

| alt =

| caption =

| pronounce =

| tradename = Zuprevo

| Drugs.com =

| MedlinePlus =

| licence_CA =

| licence_EU =

| DailyMedID = Tildipirosin

| licence_US =

| pregnancy_AU =

| pregnancy_AU_comment =

| pregnancy_category =

| routes_of_administration = Intramuscular, subcutaneous

| class =

| ATCvet = Yes

| ATC_prefix = J01

| ATC_suffix = FA96

| ATC_supplemental =

| legal_AU =

| legal_AU_comment =

| legal_BR =

| legal_BR_comment =

| legal_CA = Rx-only

| legal_CA_comment =

| legal_DE =

| legal_DE_comment =

| legal_NZ =

| legal_NZ_comment =

| legal_UK =

| legal_UK_comment =

| legal_US = Rx-only

| legal_US_comment = {{cite web | title=Zuprevo- tildipirosin injection, solution | work = DailyMed | publisher = U.S. National Library of Medicine | date=11 January 2013 | url=https://dailymed.nlm.nih.gov/dailymed/drugInfo.cfm?setid=bc52d6c2-34d7-428e-8853-a4bcbe5b6310 | access-date=21 August 2023}}{{cite book | vauthors = Budde JA, McCluskey DM |title=Plumb's Veterinary Drug Handbook |date=2023 |publisher=Wiley |isbn=978-1-394-17220-7 |page=1235 |edition=Tenth}}

| legal_EU = Rx-only

| legal_EU_comment =

| legal_UN =

| legal_UN_comment =

| legal_status =

| bioavailability =

| protein_bound =

| metabolism =

| metabolites =

| onset =

| elimination_half-life =

| duration_of_action =

| excretion =

| CAS_number = 328898-40-4

| CAS_supplemental =

| PubChem = 24860548

| IUPHAR_ligand =

| DrugBank = DB11470

| ChemSpiderID = 30790722

| UNII = S795AT66JB

| KEGG =

| ChEBI =

| ChEMBL = 3039509

| NIAID_ChemDB =

| PDB_ligand =

| synonyms =

| IUPAC_name = {{ubl|

  • (4R,5S,6S,7R,9R,11E,13E,15R,16R)-6-[(2R,3R,4S,5S,6R)-4-(Dimethylamino)-3,5-dihydroxy-6-methyloxan-2-yl]oxy-16-ethyl-4-hydroxy-5,9,13-trimethyl-7-(2-piperidin-1-ylethyl)-15-(piperidin-1-ylmethyl)-1-oxacyclohexadeca-11,13-diene-2,10-dione
  • (4R,5S,6S,7R,9R,11E,13E,15R,16R)-16-Ethyl-4-hydroxy-5,9,13-trimethyl-2,10-dioxo-7-[2-(1-piperidinyl)ethyl]-15-(1-piperidinylmethyl)oxacyclohexadeca-11,13-dien-6-yl 3,6-dideoxy-3-(dimethylamino)-β-D-glucopyranoside

}}

| C=41 | H=71 | N=3 | O=8

| SMILES = CC[C@@H]1[C@H](/C=C(/C=C/C(=O)[C@@H](C[C@@H]([C@@H]([C@H]([C@@H](CC(=O)O1)O)C)O[C@H]2[C@@H]([C@H]([C@@H]([C@H](O2)C)O)N(C)C)O)CCN3CCCCC3)C)\C)CN4CCCCC4

| StdInChI = 1S/C41H71N3O8/c1-8-35-32(26-44-20-13-10-14-21-44)23-27(2)15-16-33(45)28(3)24-31(17-22-43-18-11-9-12-19-43)40(29(4)34(46)25-36(47)51-35)52-41-39(49)37(42(6)7)38(48)30(5)50-41/h15-16,23,28-32,34-35,37-41,46,48-49H,8-14,17-22,24-26H2,1-7H3/b16-15+,27-23+/t28-,29+,30-,31+,32-,34-,35-,37+,38-,39-,40-,41+/m1/s1

| StdInChI_comment =

| StdInChIKey = HNDXPZPJZGTJLJ-UEJFNEDBSA-N

| density =

| density_notes =

| melting_point =

| melting_high =

| melting_notes =

| boiling_point =

| boiling_notes =

| solubility =

| sol_units =

| specific_rotation =

}}

Tildipirosin, sold under the brand name Zuprevo, is a macrolide antibiotic used in pigs and cattle.

Medical uses

In the United States, tildipirosin is indicated for the treatment or control of bovine respiratory disease associated with Mannheimia haemolytica, Pasteurella multocida, and Histophilus somni in beef and non-lactating dairy cattle.

In the European Union, tildipirosin is indicated for the treatment and metaphylaxis of swine respiratory disease associated with Actinobacillus pleuropneumoniae, P. multocida, Bordetella bronchiseptica, and Glaesserella parasuis sensitive to tildipirosin;{{cite web | title=Zuprevo EPAR | website=European Medicines Agency | date=3 February 2022 | url=https://www.ema.europa.eu/en/medicines/veterinary/EPAR/zuprevo | access-date=21 August 2023}} Text was copied from this source which is copyright European Medicines Agency. Reproduction is authorized provided the source is acknowledged. and for the treatment and prevention of bovine respiratory disease associated with M. haemolytica, P. multocida, and H. somni sensitive to tildipirosin.

References