tilmacoxib

{{Short description|Chemical compound}}

{{Drugbox

| IUPAC_name = 4-(4-cyclohexyl-2-methyl-1,3-oxazol-5-yl)-2-fluorobenzenesulfonamide

| image = Tilmacoxib.svg

| image_class = skin-invert-image

| width = 200

| image2 = Tilmacoxib ball-and-stick model.png

| CAS_number_Ref = {{cascite|correct|CAS}}

| CAS_number = 180200-68-4

| ATC_prefix =

| ATC_suffix =

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = G6VI5P84SX

| PubChem = 159271

| DrugBank =

| ChemSpiderID = 140082

| ChEBI_Ref = {{ebicite|correct|EBI}}

| ChEBI = 73041

| ChEMBL = 34913

| C=16 | H=19 | F=1 | N=2 | O=3 | S=1

| smiles = O=S(=O)(N)c3ccc(c1oc(nc1C2CCCCC2)C)cc3F

| StdInChI = 1S/C16H19FN2O3S/c1-10-19-15(11-5-3-2-4-6-11)16(22-10)12-7-8-14(13(17)9-12)23(18,20)21/h7-9,11H,2-6H2,1H3,(H2,18,20,21)

| StdInChIKey = MIMJSJSRRDZIPW-UHFFFAOYSA-N

| bioavailability = solution (64–88%) compared with capsule (22–40%).

| protein_bound =

| metabolism =

| elimination_half-life =

| excretion =

| pregnancy_AU =

| pregnancy_US =

| pregnancy_category =

| legal_AU =

| legal_CA =

| legal_UK =

| legal_US =

| legal_status =

| routes_of_administration =

}}

Tilmacoxib or JTE-522 is a COX-2 inhibitor and is an effective chemopreventive agent against rat experimental liver fibrosis.{{cite journal | vauthors = Yamamoto H, Kondo M, Nakamori S, Nagano H, Wakasa K, Sugita Y, Chang-De J, Kobayashi S, Damdinsuren B, Dono K, Umeshita K, Sekimoto M, Sakon M, Matsuura N, Monden M | display-authors = 6 | title = JTE-522, a cyclooxygenase-2 inhibitor, is an effective chemopreventive agent against rat experimental liver fibrosis1 | journal = Gastroenterology | volume = 125 | issue = 2 | pages = 556–71 | date = August 2003 | pmid = 12891558 | doi = 10.1016/s0016-5085(03)00904-1 | doi-access = free }}