tilomisole

{{chembox

| ImageFile = Tilomisole.svg

| ImageSize = 200px

| PIN = [3-(4-Chlorophenyl)[1,3]thiazolo[3,2-a] [1,3]benzimidazol-2-yl]acetic acid

| OtherNames =

|Section1={{Chembox Identifiers

| CASNo = 58433-11-7

| PubChem = 42747

| ChEMBL = 2104737

| ChemSpiderID = 38987

| KEGG = D06148

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = 651G60U372

| SMILES = Clc4ccc(c1c(sc2nc3ccccc3n12)CC(=O)O)cc4

| InChI = InChI=1S/C17H11ClN2O2S/c18-11-7-5-10(6-8-11)16-14(9-15(21)22)23-17-19-12-3-1-2-4-13(12)20(16)17/h1-8H,9H2,(H,21,22)

}}

|Section2={{Chembox Properties

| C=17 | H=11 | Cl=1 | N=2 | O=2 | S=1

| Appearance =

| Density =

| MeltingPt =

| BoilingPt =

| Solubility =

}}

|Section3={{Chembox Hazards

| MainHazards =

| FlashPt =

| AutoignitionPt =

}}

}}

Tilomisole (WY-18,251) is an experimental drug which acts as an immunomodulator and has been studied for the treatment of some forms of cancer.{{cite journal |vauthors=Fenichel RL, Alburn HE, Schreck PA, Bloom R, Gregory FJ |title=Immunomodulating and antimetastatic activity of 3-(p-chlorophenyl) thiazolo[3,2-a]benzimidazole-2-acetic acid (Wy-18,251, NSC 310633) |journal=Journal of Immunopharmacology |volume=2 |issue=4 |pages=491–508 |year=1980 |doi=10.3109/08923978009026408 |pmid=6970786 }}{{cite journal |vauthors=Dillman RO, Ryan KP, Dillman JB, Shawler DL, Maguire R |title=WY 18,251 (Tilomisole), an analog of levamisole: tolerability, and immune modulating effects in cancer patients |journal=Molecular Biotherapy |volume=4 |issue=1 |pages=10–4 |date=March 1992 |pmid=1385709 }}