timelotem
{{Short description|Chemical compound}}
{{Drugbox
| IUPAC_name = 10-fluoro-3-methyl-7-thiophen-2-yl-2,4,4a,5-tetrahydro-1H-pyrazino[1,2-a][1,4]benzodiazepine
| image = Timelotem.svg
| width = 200
| pregnancy_AU =
| pregnancy_US =
| pregnancy_category =
| legal_AU =
| legal_CA =
| legal_UK =
| legal_US =
| legal_status =
| routes_of_administration =
| bioavailability =
| protein_bound =
| metabolism =
| elimination_half-life =
| excretion =
| CAS_number = 96306-34-2
| ATC_prefix = none
| ATC_suffix =
| PubChem = 65844
| ChemSpiderID =
| UNII_Ref =
| UNII =
| ChEMBL =
| C=17 | H=18 | F=1 | N=3 | S=1
| smiles = CN1CCN2C(C1)CN=C(C3=C2C=C(C=C3)F)C4=CC=CS4
| StdInChI = 1S/C17H18FN3S/c1-20-6-7-21-13(11-20)10-19-17(16-3-2-8-22-16)14-5-4-12(18)9-15(14)21/h2-5,8-9,13H,6-7,10-11H2,1H3
| StdInChIKey = ICHHTOMWWAMJQP-UHFFFAOYSA-N
}}
Timelotem is a benzodiazepine derivative with an unusual activity profile. Unlike most benzodiazepines, timelotem has little or no activity at the GABAA receptor, but instead acts as an atypical antipsychotic drug with similar pharmacology and effects to the structurally related drug clozapine.{{cite journal | vauthors = Schmidt WJ, Krähling H, Ruhland M | title = Antagonism of AP-5- and amphetamine-induced behaviour by timelotem as compared with clozapine and haloperidol | journal = Life Sciences | volume = 41 | issue = 16 | pages = 1909–14 | date = October 1987 | pmid = 2889124 | doi = 10.1016/0024-3205(87)90742-9 }} It has two enantiomers, but has only been studied as the racemic mix.