timiperone

{{Short description|Typical antipsychotic medication}}

{{cs1 config|name-list-style=vanc}}

{{Drugbox

| Verifiedfields = changed

| Watchedfields = changed

| verifiedrevid = 448119914

| IUPAC_name = 1-(4-fluorophenyl)-4-[4-(2-sulfanylidene-3H-benzimidazol-1-yl)piperidin-1-yl]butan-1-one

| image = Timiperone.svg

| image_class = skin-invert-image

| width = 250px

| tradename = Tolopelon

| Drugs.com = {{drugs.com|international|timiperone}}

| pregnancy_AU =

| pregnancy_US =

| pregnancy_category =

| legal_AU =

| legal_CA =

| legal_UK =

| legal_US =

| legal_status = Rx-only

| routes_of_administration = By mouth

| bioavailability =

| protein_bound =

| metabolism =

| elimination_half-life =

| excretion =

| CAS_number_Ref = {{cascite|correct|??}}

| CAS_number = 57648-21-2

| ATC_prefix = none

| ATC_suffix =

| ATC_supplemental =

| PubChem = 3033151

| DrugBank_Ref = {{drugbankcite|correct|drugbank}}

| DrugBank =

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = 626DQ7N19L

| KEGG_Ref = {{keggcite|correct|kegg}}

| KEGG = D02035

| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}}

| ChemSpiderID = 2297930

| ChEMBL = 2107117

| C=22 | H=24 | F=1 | N=3 | O=1 | S=1

| SMILES = C1CN(CCC1N2C3=CC=CC=C3NC2=S)CCCC(=O)C4=CC=C(C=C4)F

| StdInChI_Ref = {{stdinchicite|changed|chemspider}}

| StdInChI = 1S/C22H24FN3OS/c23-17-9-7-16(8-10-17)21(27)6-3-13-25-14-11-18(12-15-25)26-20-5-2-1-4-19(20)24-22(26)28/h1-2,4-5,7-10,18H,3,6,11-15H2,(H,24,28)

| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}}

| StdInChIKey = YDLQKLWVKKFPII-UHFFFAOYSA-N

}}

Timiperone, sold under the brand name Tolopelon, is a typical antipsychotic of the butyrophenone class which is marketed in Japan for the treatment of schizophrenia.{{cite book | title = Index Nominum 2000: International Drug Directory | url = https://books.google.com/books?id=5GpcTQD_L2oC&pg=PA1030 | year = 2000 | publisher = Taylor & Francis | isbn = 978-3-88763-075-1 | pages = 1030–}}{{cite journal | vauthors = Yamasaki T, Kojima H, Tanaka M, Aibara S, Hirohashi M, Kasai Y, Tsubokawa M, Watanabe K, Akashi A | display-authors = 6 | title = Pharmacological studies on timiperone, a new neuroleptic drug Part II: General pharmacological properties | journal = Arzneimittel-Forschung | volume = 31 | issue = 4 | pages = 707–15 | year = 1981 | pmid = 6113834 }}{{cite journal | vauthors = Tanaka M, Kojima H, Akashi A | title = Effect of timiperone, a new antipsychotic drug, on the sleep-wakefulness cycle in cats | journal = Japanese Journal of Pharmacology | volume = 39 | issue = 3 | pages = 391–4 | date = November 1985 | pmid = 2869168 | doi = 10.1254/jjp.39.391 | url = http://www.journalarchive.jst.go.jp/english/jnlabstract_en.php?cdjournal=jphs1951&cdvol=39&noissue=3&startpage=391 | doi-access = free }}{{cite book | vauthors = Miyamoto S | chapter = Timiperone | date = 2010 | chapter-url = https://doi.org/10.1007/978-3-540-68706-1_1902 | title = Encyclopedia of Psychopharmacology | pages = 1323 | veditors = Stolerman IP | place = Berlin, Heidelberg | publisher = Springer | language = en | doi = 10.1007/978-3-540-68706-1_1902 | isbn = 978-3-540-68706-1 | access-date = 2022-03-11}} It is similar in chemical structure to benperidol, but has a thiourea group instead of a urea group. It acts as an antagonist for the D₂ and 5-HT_2A receptors.