timobesone

{{Short description|Chemical compound}}

{{Drugbox

| Verifiedfields =

| Watchedfields =

| verifiedrevid =

| IUPAC_name = S-Methyl (8S,9R,10S,11S,13S,14S,16S,17R)-9-Fluoro-11,17-dihydroxy-10,13,16-trimethyl-3-oxo-6,7,8,11,12,14,15,16-octahydrocyclopenta[a]phenanthrene-17-carbothioate

| image = Timobesone.svg

| width =

| tradename =

| pregnancy_AU =

| pregnancy_US =

| pregnancy_category =

| legal_AU =

| legal_CA =

| legal_UK =

| legal_US =

| legal_status =

| routes_of_administration =

| bioavailability =

| protein_bound =

| metabolism =

| elimination_half-life =

| excretion =

| CAS_number_Ref =

| CAS_number = 87116-72-1

| CAS_supplemental =

| class = Corticosteroid; Glucocorticoid

| ATC_prefix =

| ATC_suffix =

| ATC_supplemental =

| PubChem = 15986965

| IUPHAR_ligand =

| DrugBank_Ref =

| DrugBank =

| ChemSpiderID_Ref =

| ChemSpiderID =

| UNII = 97TVB2O56G

| KEGG =

| ChEBI =

| ChEMBL =

| C=22 | H=29 | F=1 | O=4 | S=1

| SMILES = C[C@H]1C[C@H]2[C@@H]3CCC4=CC(=O)C=C[C@@]4([C@]3([C@H](C[C@@]2([C@]1(C(=O)SC)O)C)O)F)C

| StdInChI_Ref =

| StdInChI = 1S/C22H29FO4S/c1-12-9-16-15-6-5-13-10-14(24)7-8-19(13,2)21(15,23)17(25)11-20(16,3)22(12,27)18(26)28-4/h7-8,10,12,15-17,25,27H,5-6,9,11H2,1-4H3/t12-,15-,16-,17-,19-,20-,21-,22-/m0/s1

| StdInChIKey_Ref =

| StdInChIKey = LNGNTCFORRWFSF-DVTGEIKXSA-N

| synonyms = 9α-Fluoro-11β,17α-dihydroxy-16α-methyl-21-methyl-21-thiapregna-1,4-dien-3,20-dione; S-Methyl 9α-fluoro-11β,17α-dihydroxy-16β-methyl-3-oxoandrosta-1,4-diene-17β-carbothioate;

}}

Timobesone is a synthetic glucocorticoid corticosteroid which was never marketed.{{cite book | vauthors = Elks J |title=The Dictionary of Drugs: Chemical Data: Chemical Data, Structures and Bibliographies|url=https://books.google.com/books?id=0vXTBwAAQBAJ&pg=PA520|date=14 November 2014|publisher=Springer|isbn=978-1-4757-2085-3|pages=520,532}}{{cite book| vauthors = Yalkowsky SH, He Y, Jain P |title=Handbook of Aqueous Solubility Data, Second Edition|url=https://books.google.com/books?id=cfFzJFthLCIC&pg=PA1292|date=19 April 2016|publisher=CRC Press|isbn=978-1-4398-0246-5|pages=1292–}}{{cite book| vauthors = Negwer M, Scharnow HG |title=Organic-chemical drugs and their synonyms: (an international survey)|url=https://books.google.com/books?id=1nBqAAAAMAAJ|year=2001|publisher=Wiley-VCH|isbn=978-3-527-30247-5|page=4145}}