timoprazole
{{Short description|Chemical compound}}
{{Drugbox
| Verifiedfields = changed
| Watchedfields = changed
| verifiedrevid = 459434734
| IUPAC_name = 2-[(2-Pyridylmethyl)sulfinyl]-1H-benzimidazole
| image = Timoprazole.svg
| CAS_number_Ref = {{cascite|correct|}}
| CAS_number = 57237-97-5
| PubChem = 72171
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| ChemSpiderID = 65144
| KEGG = D05900
| UNII = 95H6S1X9CC
| C=13 | H=11 | N=3 | O=1 | S=1
| smiles = n1ccccc1CS(=O)c2[nH]c3ccccc3n2
| StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| StdInChI = 1S/C13H11N3OS/c17-18(9-10-5-3-4-8-14-10)13-15-11-6-1-2-7-12(11)16-13/h1-8H,9H2,(H,15,16)
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
| StdInChIKey = HBDKFZNDMVLSHM-UHFFFAOYSA-N
}}
Timoprazole is in a class of medications called proton pump inhibitors (PPI) that inhibit gastric acid secretion. While it has never come to market, it was studied early on and is considered to be the "backbone" of the PPI class that succeeded it.{{cite book | vauthors = Snaeder W |year=1996 |title=Drug prototypes and their exploitation |publisher=Wiley |pages=414–5}}{{cite book |doi=10.1007/978-0-387-49785-3_49 |chapter=Case Study: Omeprazole (Prilosec) |title=Prodrugs |series=Biotechnology: Pharmaceutical Aspects |year=2007 | vauthors = Hemenway JN |isbn=978-0-387-49782-2 |pages=1313–21}} This medication has high anti-secretory activity, which flared interest along with its simple structure.{{cite book |doi=10.1002/3527608001.ch6 |chapter=The Development of a New Proton-Pump Inhibitor: The Case History of Pantoprazole |title=Analogue-based Drug Discovery |year=2006 | vauthors = Senn-Bilfinger J, Sturm E |isbn=978-3-527-60800-3 |pages=115–36}}
References
{{Reflist}}
{{Drugs for peptic ulcer and GORD}}
Category:Proton-pump inhibitors
{{gastrointestinal-drug-stub}}