tiropramide
{{Short description|Chemical compound}}
{{cs1 config|name-list-style=vanc}}
{{Drugbox
| verifiedrevid = 437195625
| IUPAC_name = Nα-benzoyl-O-[2-(diethylamino)ethyl]-N,N-dipropyltyrosinamide
| image = Tiropramide.svg
| tradename =
| Drugs.com = {{drugs.com|international|tiropramide}}
| pregnancy_AU =
| pregnancy_US =
| pregnancy_category =
| legal_AU =
| legal_CA =
| legal_UK =
| legal_US =
| legal_status =
| routes_of_administration =
| bioavailability =
| protein_bound =
| metabolism =
| elimination_half-life =
| excretion =
| CAS_number = 55837-29-1
| ATC_prefix = A03
| ATC_suffix = AC05
| ATC_supplemental =
| PubChem = 42262
| DrugBank_Ref = {{drugbankcite|correct|drugbank}}
| DrugBank =
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = R7S0904CN2
| KEGG_Ref = {{keggcite|correct|kegg}}
| KEGG = D07087
| ChemSpiderID = 38541
| ChEMBL = 2104688
| chemical_formula =
| C=28 | H=41 | N=3 | O=3
| synonyms = N-[3-[4-(2-Diethylaminoethoxy)phenyl]-1-(dipropylamino)-1-oxopropan-2-yl]benzamide
| StdInChI = 1S/C28H41N3O3/c1-5-18-31(19-6-2)28(33)26(29-27(32)24-12-10-9-11-13-24)22-23-14-16-25(17-15-23)34-21-20-30(7-3)8-4/h9-17,26H,5-8,18-22H2,1-4H3,(H,29,32)
| StdInChIKey = FDBWMYOFXWMGEY-UHFFFAOYSA-N
| smiles = CCCN(CCC)C(=O)C(Cc1ccc(cc1)OCCN(CC)CC)NC(=O)c2ccccc2
}}
Tiropramide is the International nonproprietary name of an antispasmodic drug.{{cite journal | vauthors = Vidal y Plana RR, Cifarelli A, Setnikar I | title = Mechanism of smooth muscle relaxation by tiropramide | journal = The Journal of Pharmacy and Pharmacology | volume = 33 | issue = 1 | pages = 19–24 | date = January 1981 | pmid = 6114146 | doi = 10.1111/j.2042-7158.1981.tb13694.x | s2cid = 22487894 }}
Synthesis
The acylation of racemic tyrosine (1) with benzoyl chloride gives N,O-dibenzoyl-tyrosine (2). Amide formation with dipropylamine (3) using the mixed anhydride method gives the intermediate (4). Hydrolysis of the phenolic ester with sodium hydroxide forms (5), which is alkylated with {{chem2|ClCH2CH2N(CH2CH3)2}} to produce the ether tiropramide.Francesco Makovec, Luigi Rovati, Paolo Senin, {{US patent|4004008}} (1977 to Rotta Research Laboratorium S.P.A.){{cite web |url=https://pharmaceutical-substances.thieme.com/ps/search-results?docUri=KD-20-0113 |title=Tiropramide |publisher=Thieme |access-date=2024-07-01 }}
References
{{Reflist}}
{{Drugs for functional gastrointestinal disorders}}
Category:Drugs acting on the gastrointestinal system and metabolism
Category:Diethylamino compounds
Category:Dipropylamino compounds
{{gastrointestinal-drug-stub}}