tomopenem
{{Chembox
| ImageFile = Tomopenem structure.svg
| ImageSize = 300
| ImageAlt =
| IUPACName = (4R,5S,6S)-3-[(3S,5S)-5-[(3S)-3-
| OtherNames =
|Section1={{Chembox Identifiers
| CASNo = 222400-20-6
| CASNo_Ref = {{cascite|correct|CAS}}
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = 1654W9611T
| PubChem = 9809656
| KEGG = D09022
| ChemSpiderID = 7985412
| SMILES = C[C@@H]1[C@@H]2[C@H](C(=O)N2C(=C1S[C@H]3C[C@H](N(C3)C)C(=O)N4CC[C@@H](C4)NC(=O)CNC(=N)N)C(=O)O)[C@@H](C)O
| StdInChI = 1S/C23H35N7O6S/c1-10-17-16(11(2)31)21(34)30(17)18(22(35)36)19(10)37-13-6-14(28(3)9-13)20(33)29-5-4-12(8-29)27-15(32)7-26-23(24)25/h10-14,16-17,31H,4-9H2,1-3H3,(H,27,32)(H,35,36)(H4,24,25,26)/t10-,11-,12+,13+,14+,16-,17-/m1/s1
| StdInChIKey = KEDAXBWZURNCHS-GPODMPQUSA-N
}}
|Section2={{Chembox Properties
| C=23 | H=35 | N=7 | O=6 | S=1
| Appearance =
| Density =
| MeltingPt =
| BoilingPt =
| Solubility =
}}
|Section3={{Chembox Hazards
| MainHazards =
| FlashPt =
| AutoignitionPt = }}
}}
Tomopenem (formerly CS-023) is a carbapenem β-lactam antibiotic.{{Cite journal | pmid = 21844314 | date = 2011 | last1 = Sugihara | first1 = K. | last2 = Tateda | first2 = K. | last3 = Yamamura | first3 = N. | last4 = Koga | first4 = T. | last5 = Sugihara | first5 = C. | last6 = Yamaguchi | first6 = K. | title = Efficacy of human-simulated exposures of tomopenem (Formerly CS-023) in a murine model of Pseudomonas aeruginosa and methicillin-resistant Staphylococcus aureus infection | journal = Antimicrobial Agents and Chemotherapy | volume = 55 | issue = 11 | pages = 5004–5009 | doi = 10.1128/AAC.00068-11 | pmc = 3195026 }}