topiroxostat

{{short description|Chemical compound}}

{{Infobox drug

| drug_name =

| IUPAC_name = 4-[5-(4-Pyridinyl)-1H-1,2,4-triazol-3-yl]-2-pyridinecarbonitrile

| image = Topiroxostat.svg

| alt =

| caption =

| tradename = Topiloric, Uriadec

| Drugs.com =

| MedlinePlus =

| pregnancy_AU =

| pregnancy_US =

| pregnancy_category=

| legal_AU =

| legal_CA =

| legal_UK =

| legal_US =

| legal_status = Approved in Japan

| routes_of_administration =

| bioavailability =

| protein_bound =

| metabolism =

| elimination_half-life =

| excretion =

| CAS_number = 577778-58-6

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = 0J877412JV

| ATCvet =

| ATC_prefix = None

| ATC_suffix =

| PubChem = 5288320

| ChemSpiderID = 4450517

| DrugBank =

| smiles = C1=CN=CC=C1C2=NC(=NN2)C3=CC(=NC=C3)C#N

| StdInChI = 1S/C13H8N6/c14-8-11-7-10(3-6-16-11)13-17-12(18-19-13)9-1-4-15-5-2-9/h1-7H,(H,17,18,19)

| StdInChIKey = UBVZQGOVTLIHLH-UHFFFAOYSA-N

| C=13 | H=8 | N=6

}}

Topiroxostat (INN; trade names Topiloric, Uriadec) is a drug for the treatment of gout and hyperuricemia.{{cite | url = http://www.pmda.go.jp/english/service/pdf/list/NewdrugsFY2013.pdf | title = New Drugs FY2013 | publisher = Pharmaceuticals and Medical Devices Agency, Japan | url-status = dead | archive-url = https://web.archive.org/web/20140222175138/http://www.pmda.go.jp/english/service/pdf/list/NewdrugsFY2013.pdf | archive-date = 2014-02-22 }} It was approved for use in Japan in June 2013.

Topiroxostat is a xanthine oxidase inhibitor which reduces serum urate levels.{{cite journal | vauthors = Hosoya T, Ohno I, Nomura S, Hisatome I, Uchida S, Fujimori S, Yamamoto T, Hara S | display-authors = 6 | title = Effects of topiroxostat on the serum urate levels and urinary albumin excretion in hyperuricemic stage 3 chronic kidney disease patients with or without gout | journal = Clinical and Experimental Nephrology | volume = 18 | issue = 6 | pages = 876–84 | date = December 2014 | pmid = 24448692 | pmc = 4271138 | doi = 10.1007/s10157-014-0935-8 }}