tosifen

{{Short description|Possible heart rhythm drug}}

{{cs1 config|name-list-style=vanc|display-authors=6}}

{{Infobox drug

| drug_name = Tosifen

| image = Tosifen.svg

| width =

| caption =

| pronounce =

| tradename =

| Drugs.com =

| MedlinePlus =

| licence_CA =

| licence_EU =

| DailyMedID =

| licence_US =

| pregnancy_AU =

| pregnancy_category =

| dependency_liability =

| addiction_liability =

| routes_of_administration =

| class =

| ATC_prefix =

| ATC_suffix =

| legal_status =

| bioavailability =

| protein_bound =

| metabolism =

| metabolites =

| onset =

| elimination_half-life =

| duration_of_action =

| excretion =

| CAS_number = 32295-18-4

| CAS_supplemental =

| PubChem = 36102

| IUPHAR_ligand =

| DrugBank =

| ChemSpiderID = 33207

| UNII = OK1IHO7PG8

| KEGG =

| ChEBI =

| ChEMBL = 2105565

| NIAID_ChemDB =

| PDB_ligand =

| synonyms = Sch 11973

| IUPAC_name = 1-(4-methylphenyl)sulfonyl-3-[(2S)-1-phenylpropan-2-yl]urea

| C=17 | H=20 | N=2 | O=3 | S=1

| SMILES = CC1=CC=C(C=C1)S(=O)(=O)NC(=O)N[C@@H](C)CC2=CC=CC=C2

| StdInChI = 1S/C17H20N2O3S/c1-13-8-10-16(11-9-13)23(21,22)19-17(20)18-14(2)12-15-6-4-3-5-7-15/h3-11,14H,12H2,1-2H3,(H2,18,19,20)/t14-/m0/s1

| StdInChIKey = XILWEASNBDKGSA-AWEZNQCLSA-N

}}

Tosifen is a drug candidate for use as an antiarrhythmic agent. Tosifen was synthesized originally in a series of compounds whose basic structural moiety, the sulfonylurea nucleus, was of interest for potential hypoglycemic action. But tosifen is only a weak hypoglycemic agent. It is a potential antianginal and antiarrhythmic agent. The duration of action of tosifen was considerably longer than nitroglycerin and its lack of side effects considerably greater than propranolol. No long-term harmful effects have been observed during 13-week toxicity studies in animals. Tosifen differed from standard antianginal agents which may act via beta-adrenergic blocking activity or alteration of cardiac or circulatory dynamics since no acute pharmacological changes were observed after tosifen was administered. Tosifen was readily absorbed in both rats and dogs. The rates of absorption, metabolism, and urinary excretion were higher in the rat than in the dog.

Attribution:{{cite web | title = NCATS Inxight Drugs — TOSIFEN | url = https://drugs.ncats.io/drug/OK1IHO7PG8 }} Review:{{cite journal | title = Tosifen | journal = Drugs of the Future | volume = 3 | issue = 7 | pages = 553 | date = 1978 | doi = 10.1358/dof.1978.003.07.998266 | issn = 0377-8282 | vauthors = Castañer J, Weetman D }} Pharmacology:{{cite journal | vauthors = Zitowitz L, Stimson J, Wohl AJ, Ehrreich SJ | title = Pharmacology of Sch 11973, N-(2-phenylisopropyl)-Np-toluene sulfonyl urea, a potential new antianginal agent. | journal = Japanese Journal of Pharmacology | volume = 27 | issue = 6 | pages = 769–779 | date = 1977 | pmid = 24776 | doi = 10.1254/jjp.27.769 | issn = 0021-5198 | doi-access = free }} ADME:{{cite journal | vauthors = Lin C, Foester R, Lim J, Hsu T, Morton JB, Symchowicz S | title = Absorption, metabolism, and excretion of 14C-tosifen in the dog and rat | journal = Drug Metabolism and Disposition: The Biological Fate of Chemicals | volume = 6 | issue = 1 | pages = 50–58 | date = 1978 | doi = 10.1016/S0090-9556(25)06310-X | pmid = 23274 }}