tracazolate

{{Short description|Chemical compound}}

{{distinguish|cartazolate}}

{{Drugbox

| IUPAC_name = Ethyl 4-(butylamino)-1-ethyl-6-methyl-1H-pyrazolo[3,4-b]pyridine-5-carboxylate

| image = Tracazolate.svg

| tradename =

| pregnancy_category =

| legal_status = Uncontrolled

| routes_of_administration = By mouth

| bioavailability =

| metabolism =

| elimination_half-life =

| excretion =

| IUPHAR_ligand = 5467

| CAS_number = 41094-88-6

| ATC_prefix = None

| ATC_suffix =

| PubChem = 5522

| ChemSpiderID = 5321

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = NH0HPL3U1T

| KEGG = D06200

| ChEBI = 92596

| ChEMBL = 84567

| C=16 | H=24 | N=4 | O=2

| smiles = O=C(OCC)c1c(c2c(nc1C)n(nc2)CC)NCCCC

| StdInChI = 1S/C16H24N4O2/c1-5-8-9-17-14-12-10-18-20(6-2)15(12)19-11(4)13(14)16(21)22-7-3/h10H,5-9H2,1-4H3,(H,17,19)

| StdInChIKey = PCTRYMLLRKWXGF-UHFFFAOYSA-N

}}

Tracazolate (ICI-136,753) is an anxiolytic drug which is used in scientific research. It is a pyrazolopyridine derivative, most closely related to pyrazolopyrimidine drugs such as zaleplon, and is one of a structurally diverse group of drugs known as the nonbenzodiazepines which act at the same receptor targets as benzodiazepines but have distinct chemical structures.{{cite journal | vauthors = Patel JB, Malick JB, Salama AI, Goldberg ME | title = Pharmacology of pyrazolopyridines | journal = Pharmacology, Biochemistry, and Behavior | volume = 23 | issue = 4 | pages = 675–80 | date = October 1985 | pmid = 2866547 | doi = 10.1016/0091-3057(85)90436-8 | s2cid = 31584179 }}

Tracazolate has primarily anxiolytic and anticonvulsant effects, with sedative and muscle relaxant effects only appearing at higher doses.{{cite journal | vauthors = Patel JB, Malick JB | title = Pharmacological properties of tracazolate: a new non-benzodiazepine anxiolytic agent | journal = European Journal of Pharmacology | volume = 78 | issue = 3 | pages = 323–33 | date = March 1982 | pmid = 6121711 | doi = 10.1016/0014-2999(82)90034-6 }} It has a unique receptor binding profile involving allosteric modulation of several GABAA receptor subtypes, being selective for GABAA receptors containing α1 and β3 subunits, but exhibiting different effects depending on the third type of subunit making up the receptor complex.{{cite journal | vauthors = Thompson SA, Wingrove PB, Connelly L, Whiting PJ, Wafford KA | title = Tracazolate reveals a novel type of allosteric interaction with recombinant gamma-aminobutyric acid(A) receptors | journal = Molecular Pharmacology | volume = 61 | issue = 4 | pages = 861–9 | date = April 2002 | pmid = 11901225 | doi = 10.1124/mol.61.4.861 | s2cid = 7039885 }}

See also

References