trachyspic acid

{{Chembox

| ImageFile = Trachyspic acid Structure.svg

| ImageSize =

| ImageAlt =

| IUPACName = 2-(Carboxymethyl)-8-nonyl-9-oxo-1,6-dioxaspiro[4.4]non-7-ene-2,3-dicarboxylic acid

| OtherNames =

|Section1={{Chembox Identifiers

| CASNo = 149718-37-6

| CASNo_Ref = {{Cascite|changed|PubChem}}

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = VJA25444QX

| PubChem = 9909587

| ChEBI_Ref = {{ebicite|correct|EBI}}

| ChEBI = 66260

| ChemSpiderID = 58539306

| SMILES = CCCCCCCCC1=CO[C@]2(C1=O)C[C@H]([C@](O2)(CC(=O)O)C(=O)O)C(=O)O

| StdInChI = 1S/C19H26O9/c1-2-3-4-5-6-7-8-12-11-27-19(15(12)22)9-13(16(23)24)18(28-19,17(25)26)10-14(20)21/h11,13H,2-10H2,1H3,(H,20,21)(H,23,24)(H,25,26)/t13-,18+,19+/m0/s1

| StdInChIKey = NYTZRXWHGZGDDX-MJXNMMHHSA-N

}}

|Section2={{Chembox Properties

| C=20 | H=28 | O=9

| Appearance =

| Density =

| MeltingPt =

| BoilingPt =

| Solubility = }}

|Section3={{Chembox Hazards

| MainHazards =

| FlashPt =

| AutoignitionPt = }}

}}

Trachyspic acid is a fungal isolate that can inhibit heparanase.{{cite journal | pmid = 7797435 | title = Trachyspic acid, a new metabolite produced by Talaromyces trachyspermus, that inhibits tumor cell heparanase: taxonomy of the producing strain, fermentation, isolation, structural elucidation, and biological activity | journal = J Antibiot (Tokyo) | year = 1995 | volume = 48 | issue = 5 | pages = 357–362 |vauthors=Shiozawa H, Takahashi M, Takatsu T, Kinoshita T, Tanzawa K, Hosoya T, Furuya K, Takahashi S, Furihata K, Seto H | doi = 10.7164/antibiotics.48.357| doi-access = free }}