trepipam

{{short description|Chemical compound}}

{{Drugbox

| Watchedfields =

| verifiedrevid =

| image = Trepipam.svg

| width =

| tradename =

| Drugs.com =

| MedlinePlus =

| licence_US =

| pregnancy_AU =

| pregnancy_US =

| legal_AU =

| legal_CA =

| legal_UK =

| legal_US =

| legal_status =

| dependency_liability =

| routes_of_administration =

| bioavailability =

| protein_bound =

| metabolism =

| elimination_half-life =

| excretion =

| CAS_number_Ref =

| CAS_number = 56030-50-3

| ATC_prefix =

| ATC_suffix =

| PubChem = 91277

| DrugBank_Ref =

| DrugBank =

| ChemSpiderID = 4849

| UNII_Ref =

| UNII = 8LMO6J899I

| KEGG_Ref =

| KEGG =

| ChEBI_Ref =

| ChEBI =

| ChEMBL_Ref =

| ChEMBL =

| synonyms = SCH-12679; SCH12679

| IUPAC_name = (5R)-7,8-dimethoxy-3-methyl-5-phenyl-1,2,4,5-tetrahydro-3-benzazepine

| chemical_formula =

| C=19 | H=23 | Ag= | Al= | As= | Au= | B= | Bi= | Br= | Ca= | Cl= | Co= | F= | Fe= | Gd= | I=

| K= | Li= | Mg= | Mn= | N=1 | Na= | O=2 | P= | Pt= | S= | Sb= | Se= | Sr= | Tc= | Zn= | charge=

| molecular_weight =

| SMILES = CN1CCC2=CC(=C(C=C2C(C1)C3=CC=CC=C3)OC)OC

| Jmol =

| StdInChI = 1S/C19H23NO2/c1-20-10-9-15-11-18(21-2)19(22-3)12-16(15)17(13-20)14-7-5-4-6-8-14/h4-8,11-12,17H,9-10,13H2,1-3H3/t17-/m1/s1

| StdInChI_comment =

| StdInChIKey = ICPHJSKVAZMKIV-QGZVFWFLSA-N

| density = 1.072 ± 0.06

| density_notes = (predicted)

| melting_point = 105-106

| melting_high =

| melting_notes = (experimental)

| boiling_point = 416.8 ± 45.0

| boiling_notes = (predicted)

| solubility =

| sol_units =

| specific_rotation = +31.8°

}}

Trepipam ({{Abbrlink|INN|International Nonproprietary Name}}; developmental code name SCH-12679) is a dopamine receptor agonist of the benzazepine group that was never marketed.{{cite book| vauthors = Lednicer D |title=Strategies for Organic Drug Synthesis and Design|url=https://books.google.com/books?id=fEwl6Qev-mUC&pg=PA495|date=4 March 2009|publisher=John Wiley & Sons|isbn=978-0-470-39959-0|pages=495–}} It acts specifically as an agonist of the dopamine D₁ receptor.{{cite journal | vauthors = Goode-Romero G, Winnberg U, Domínguez L, Ibarra IA, Vargas R, Winnberg E, Martínez A | title = New information of dopaminergic agents based on quantum chemistry calculations | journal = Sci Rep | volume = 10 | issue = 1 | pages = 21581 | date = December 2020 | pmid = 33299000 | pmc = 7725812 | doi = 10.1038/s41598-020-78446-4 | bibcode = 2020NatSR..1021581G | url = }} It is closed related structurally to fenoldopam, a peripherally acting selective D₁ receptor partial agonist which is used as an antihypertensive agent.