trimetrexate

{{Short description|Chemical compound}}

{{Drugbox

| verifiedrevid = 470615984

| IUPAC_name = 5-methyl-6-[(3,4,5-trimethoxyphenyl) aminomethyl] quinazoline-2,4-diamine

| image = Trimetrexate.svg

| width = 250

| tradename =

| Drugs.com = {{drugs.com|CDI|trimetrexate}}

| MedlinePlus = a694019

| pregnancy_category =

| legal_status =

| routes_of_administration =

| bioavailability = VD: 20-30 Liters

| protein_bound =

| metabolism = Oxidative O-demethylation, followed by conjugation with glucuronide or sulfate

| elimination_half-life = 11 to 12 hours

| IUPHAR_ligand = 7613

| CAS_number_Ref = {{cascite|correct|??}}

| CAS_number = 52128-35-5

| ATC_prefix = P01

| ATC_suffix = AX07

| ATC_supplemental =

| PubChem = 5583

| DrugBank_Ref = {{drugbankcite|correct|drugbank}}

| DrugBank = DB01157

| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}

| ChemSpiderID = 5381

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = UPN4ITI8T4

| KEGG_Ref = {{keggcite|correct|kegg}}

| KEGG = D06238

| ChEMBL_Ref = {{ebicite|correct|EBI}}

| ChEMBL = 119

| C=19 | H=23 | N=5 | O=3

| smiles = n3c1c(c(c(cc1)CNc2cc(OC)c(OC)c(OC)c2)C)c(nc3N)N

| StdInChI_Ref = {{stdinchicite|correct|chemspider}}

| StdInChI = 1S/C19H23N5O3/c1-10-11(5-6-13-16(10)18(20)24-19(21)23-13)9-22-12-7-14(25-2)17(27-4)15(8-12)26-3/h5-8,22H,9H2,1-4H3,(H4,20,21,23,24)

| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}

| StdInChIKey = NOYPYLRCIDNJJB-UHFFFAOYSA-N

}}

Trimetrexate is a quinazoline derivative. It is a dihydrofolate reductase inhibitor.{{cite journal |vauthors =Wong BK, Woolf TF, Chang T, Whitfield LR |title=Metabolic disposition of trimetrexate, a nonclassical dihydrofolate reductase inhibitor, in rat and dog |journal=Drug Metab. Dispos. |volume=18 |issue=6 |pages=980–6 |year=1990 |pmid=1981548 |url=http://dmd.aspetjournals.org/cgi/pmidlookup?view=long&pmid=1981548}}

Uses

It has been used with leucovorin in treating pneumocystis pneumonia.{{cite journal |vauthors=Sattler FR, Allegra CJ, Verdegem TD, etal |title=Trimetrexate-leucovorin dosage evaluation study for treatment of Pneumocystis carinii pneumonia |journal=J. Infect. Dis. |volume=161 |issue=1 |pages=91–6 |date=January 1990 |pmid=2136905 |doi= 10.1093/infdis/161.1.91}}

It has been investigated for use in treating leiomyosarcoma.{{cite journal |vauthors =Smith HO, Blessing JA, Vaccarello L |title=Trimetrexate in the treatment of recurrent or advanced leiomyosarcoma of the uterus: a phase II study of the Gynecologic Oncology Group |journal=Gynecol. Oncol. |volume=84 |issue=1 |pages=140–4 |date=January 2002 |pmid=11748990 |doi=10.1006/gyno.2001.6482 }}

It is a methotrexate (MTX) analog that is active against transport-deficient MTX-resistant tumor cells that overcome the acquired and natural resistance to methotrexate. Other uses include skin lymphoma. Trimetrexate in relapsed T-cell lymphoma with skin involvement. J Clin Oncol. 2002 Jun 15;20(12):2876-80.

References

{{reflist}}