triprene

{{Short description |Defunct insecticide}}

{{Chembox

| Name = Triprene

| ImageFile = Triprene.svg

| OtherNames = ZR 619, Altorick, Altoric, ZR 519 (suspected typo)

| IUPACName = S-Ethyl (E,E)-(7R/S)-11-methoxy-3,7,11-trimethyldodeca-2,4-dienethioate

| SystematicName =

|Section1={{Chembox Identifiers

| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}

| ChemSpiderID = 4944101

| KEGG_Ref = {{keggcite|correct|kegg}}

| KEGG =

| ChEBI_Ref = {{ebicite|changed|EBI}}

| ChEBI =

| InChI = 1S/C18H32O2S/c1-7-21-17(19)14-16(3)11-8-10-15(2)12-9-13-18(4,5)20-6/h8,11,14-15H,7,9-10,12-13H2,1-6H3/b11-8+,16-14+

| InChIKey = YGBMMMOLNODPBP-GWGZPXPZNA-N

| StdInChI_Ref = {{stdinchicite|correct|chemspider}}

| StdInChI =

| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}

| StdInChIKey =

| CASNo_Ref = {{cascite|correct|CAS}}

| CASNo = 40596-80-3

| PubChem = 6439708

| UNII = 888S6M89C1

| ChEMBL = 36831

| SMILES = C(CCCC(C/C=C/C(=C/C(SCC)=O)/C)C)(OC)(C)C

}}

| Section2 = {{Chembox Properties

| C=18|H=32|O=2|S=1

| Appearance = Amber liquid{{cite web |title=Article about triprene |url=https://encyclopedia2.thefreedictionary.com/triprene |publisher=The Free Dictionary |access-date=8 September 2024}}

| Density = 800-1000 kg/m³ (Predicted)

| MeltingPtC =

| MeltingPt_notes =

| BoilingPt =

| BoilingPt_notes =

| Solubility =

| Solvent1 = acetone

| Solubility1 =

| VaporPressure =

}}

| Section3 = {{Chembox Hazards

| MainHazards =

| FlashPt = 179-201 °C{{cite web |title=triprene C18H3202S |url=https://www.chemspider.com/Chemical-Structure.4944101.html |publisher=Chemspider |access-date=8 September 2024}} (Predicted)

| AutoignitionPt =

}}

}}

Triprene is an insecticide that is no longer in use. It is an insect growth regulator introduced by Zoecon Corporation (now Sandoz AG) under the "Altorick" trademark,{{cite book |last1=Tomlin |first1=Clive |title=The Pesticide Manual Incorporating the Agrochemicals Handbook |date=1994 |publisher=The Royal Society of Chemistry |location=State Library of Western Australia |isbn=0-948404-79-5 |edition=Tenth}} registered 1974 and not renewed, expiring in 1980.{{cite web |title=ALTORICK Trademark |url=https://trademarks.justia.com/809/79/altorick-80979224.html |website=trademarks.justia.com |access-date=27 August 2024}} The EPA records no registration, now or past.{{cite web |title=Triprene - Chemical Details |url=https://ordspub.epa.gov/ords/pesticides/f?p=CHEMICALSEARCH:3:0::NO:21,3,31,7,12,25:P3_XCHEMICAL_ID:4170# |publisher=United States Environmental Protection Agency |access-date=8 September 2024}}

Triprene is nontoxic to mammals, non-carcinogenic, not a human endocrine disruptor, and not neurotoxic. To fish, it may be of moderate toxicity.{{cite journal |last1=Lewis |first1=Kathleen A. |last2=Tzilivakis |first2=John |last3=Warner |first3=Douglas J. |last4=Green |first4=Andrew |title=An international database for pesticide risk assessments and management |journal=Human and Ecological Risk Assessment|date=18 May 2016 |volume=22 |issue=4 |pages=1050–1064 |doi=10.1080/10807039.2015.1133242 |bibcode=2016HERA...22.1050L |hdl=2299/17565 |url=http://sitem.herts.ac.uk/aeru/ppdb/en/Reports/2596.htm |access-date=25 August 2024|hdl-access=free }}

Triprene is a juvenile hormone mimic.{{cite web |title=Triprene data sheet |url=http://www.bcpcpesticidecompendium.org/triprene.html |access-date=27 August 2024}} It disrupts insects' development by endocrine disruption, causing incomplete pupation and sterile adult insects.