triptofordin C-2

{{Chembox

| ImageFile = (-)-triptofordin C2.svg

| ImageSize = 150px

| ImageAlt =

| IUPACName =

| OtherNames =

|Section1={{Chembox Identifiers

| CASNo = 111514-63-7

| CASNo_Ref = {{Cascite|changed|EPA}}

| PubChem = 130681

| ChemSpiderID = 115588

| ChEBI_Ref = {{ebicite|correct|EBI}}

| ChEBI = 132152

| StdInChI=1S/C33H38O11/c1-18(34)40-25-22(36)17-31(5,39)33-26(41-19(2)35)23(30(3,4)44-33)24(42-28(37)20-13-9-7-10-14-20)27(32(25,33)6)43-29(38)21-15-11-8-12-16-21/h7-16,22-27,36,39H,17H2,1-6H3/t22-,23-,24-,25-,26-,27-,31-,32-,33?/m1/s1

| StdInChIKey = FOIOSVGAFMLLDU-QGCFOTDLSA-N

| SMILES = CC(=O)O[C@@H]1[C@@H](C[C@@](C23[C@]1([C@@H]([C@@H]([C@H]([C@H]2OC(=O)C)C(O3)(C)C)OC(=O)C4=CC=CC=C4)OC(=O)C5=CC=CC=C5)C)(C)O)O

}}

|Section2={{Chembox Properties

| C=33 | H=38 | O=11

| Formula =

| MolarMass =

| Appearance =

| Density =

| MeltingPt =

| BoilingPt =

| Solubility = }}

|Section3={{Chembox Hazards

| MainHazards =

| FlashPt =

| AutoignitionPt = }}

}}

Triptofordin C-2 is an antiviral chemical compound isolated from Tripterygium wilfordii.{{cite journal | pmid = 8722541 | title = Characterization of antiviral activity of a sesquiterpene, triptofordin C-2 | author = K Hayashi, T Hayashi, K Ujita, Y Takaishi | journal = J Antimicrob Chemother | date = 1996 | volume = 37 | issue = 4 | pages = 759–68 | doi = 10.1093/jac/37.4.759 | doi-access = free }}